| id | C00017103 | 
|---|---|
| Name | BE 13793C | 
| CAS RN | 133805-03-5 | 
| Standard InChI | InChI=1S/C20H11N3O4/c24-9-5-1-3-7-11-13-14(20(27)23-19(13)26)12-8-4-2-6-10(25)16(8)22-18(12)17(11)21-15(7)9/h1-6,21-22,24-25H,(H,23,26,27) | 
| Standard InChI (Main Layer) | InChI=1S/C20H11N3O4/c24-9-5-1-3-7-11-13-14(20(27)23-19(13)26)12-8-4-2-6-10(25)16(8)22-18(12)17(11)21-15(7)9/h1-6,21-22,24-25H,(H,23,26,27) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1236 | 
| By standard InChI | CHEMBL279481 | 
|---|---|
| By standard InChI Main Layer | CHEMBL279481 | 
| By LinkDB | 
|---|
| By CAS RN | C070538 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Streptomycetaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Streptomyces mobaraensis BA13793 | 1883 | Streptomycetaceae | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL279481 | CHEMBL769353
                        (1) | 0 / 0 | 
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL279481 | CHEMBL675381
                        (1) | 1 / 11 | 
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL279481 | CHEMBL842782
                        (1) | 0 / 0 | 
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL279481 | CHEMBL842783
                        (1) | 0 / 0 | 
| Q02880 | DNA topoisomerase 2-beta | Isomerase | CHEMBL279481 | CHEMBL842783
                        (1) | 0 / 0 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00016 | Oral cancer | P00533
                            (related) P00533 (marker) | 
| H00017 | Esophageal cancer | P00533
                            (related) | 
| H00018 | Gastric cancer | P00533
                            (related) | 
| H00022 | Bladder cancer | P00533
                            (related) | 
| H00028 | Choriocarcinoma | P00533
                            (related) | 
| H00030 | Cervical cancer | P00533
                            (related) | 
| H00042 | Glioma | P00533
                            (related) P00533 (marker) | 
| H00055 | Laryngeal cancer | P00533
                            (related) P00533 (marker) |