id | C00001741 |
---|---|
Name | Ibogaine |
CAS RN | 83-74-9 |
Standard InChI | InChI=1S/C20H26N2O/c1-3-13-8-12-9-17-19-15(6-7-22(11-12)20(13)17)16-10-14(23-2)4-5-18(16)21-19/h4-5,10,12-13,17,20-21H,3,6-9,11H2,1-2H3/t12-,13+,17+,20+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H26N2O/c1-3-13-8-12-9-17-19-15(6-7-22(11-12)20(13)17)16-10-14(23-2)4-5-18(16)21-19/h4-5,10,12-13,17,20-21H,3,6-9,11H2,1-2H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 2446 |
By standard InChI | CHEMBL1215855 |
---|---|
By standard InChI Main Layer | CHEMBL222287 CHEMBL1215855 |
By LinkDB | C09214 |
---|
By CAS RN | D007050 |
---|
class name | count |
---|---|
asterids | 4 |
family name | count |
---|---|
Apocynaceae | 4 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Ervatamia officinalis | 4056 | Apocynaceae | asterids | Viridiplantae |
Tabernaemontana bovina | 52860 | Apocynaceae | asterids | Viridiplantae |
Tabernanthe iboga | 141617 | Apocynaceae | asterids | Viridiplantae |
Voacanga thouarsii | 1237849 | Apocynaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P31645 | Sodium-dependent serotonin transporter | Serotonin | CHEMBL222287 |
CHEMBL977948
(1)
|
2 / 0 |
OMIM | preferred title | UniProt |
---|---|---|
#103780 | Alcohol dependence |
P31645
|
#164230 | Obsessive-compulsive disorder; ocd |
P31645
|