id | C00001764 |
---|---|
Name | Rhynchophylline |
CAS RN | 76-66-4 |
Standard InChI | InChI=1S/C22H28N2O4/c1-4-14-12-24-10-9-22(17-7-5-6-8-18(17)23-21(22)26)19(24)11-15(14)16(13-27-2)20(25)28-3/h5-8,13-15,19H,4,9-12H2,1-3H3,(H,23,26)/b16-13+/t14-,15-,19-,22+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C22H28N2O4/c1-4-14-12-24-10-9-22(17-7-5-6-8-18(17)23-21(22)26)19(24)11-15(14)16(13-27-2)20(25)28-3/h5-8,13-15,19H,4,9-12H2,1-3H3,(H,23,26) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 154 |
By standard InChI | CHEMBL519266 |
---|---|
By standard InChI Main Layer | CHEMBL519266 CHEMBL480521 CHEMBL1909423 CHEMBL1909424 |
By LinkDB | C09236 |
---|
By CAS RN | C052714 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Mitragyna africana | 170021 | Rubiaceae | asterids | Viridiplantae |
Mitragyna africanus WILLD. | 170021 | Rubiaceae | asterids | Viridiplantae |
Mitragyna hirsuta | 371154 | Rubiaceae | asterids | Viridiplantae |
Mitragyna rotundifolia | 170024 | Rubiaceae | asterids | Viridiplantae |
Uncaria rhynchophylla | 43575 | Rubiaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL519266 |
CHEMBL1051458
(1)
CHEMBL1052982
(1)
CHEMBL1052984 (1) |
2 / 2 |
P16389 | Potassium voltage-gated channel subfamily A member 2 | KCNA, Kv1.x (Shaker) | CHEMBL519266 |
CHEMBL1052983
(1)
|
0 / 0 |