id | C00017836 |
---|---|
Name | Galactostatin |
CAS RN | 107537-94-0 |
Standard InChI | InChI=1S/C6H13NO5/c8-1-2-3(9)4(10)5(11)6(12)7-2/h2-12H,1H2/t2-,3+,4+,5-,6?/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C6H13NO5/c8-1-2-3(9)4(10)5(11)6(12)7-2/h2-12H,1H2 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 667 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL35691 CHEMBL120638 |
By LinkDB |
---|
By CAS RN | C051195 |
---|
class name | count |
---|
family name | count |
---|---|
Streptomycetaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Streptomyces lydicus PA-5726 | 1883 | Streptomycetaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O43451 | Maltase-glucoamylase, intestinal | Hydrolase | CHEMBL120638 |
CHEMBL683913
(1)
|
0 / 0 |