| id | C00017836 | 
|---|---|
| Name | Galactostatin | 
| CAS RN | 107537-94-0 | 
| Standard InChI | InChI=1S/C6H13NO5/c8-1-2-3(9)4(10)5(11)6(12)7-2/h2-12H,1H2/t2-,3+,4+,5-,6?/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C6H13NO5/c8-1-2-3(9)4(10)5(11)6(12)7-2/h2-12H,1H2 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 667 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL35691 CHEMBL120638 | 
| By LinkDB | 
|---|
| By CAS RN | C051195 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Streptomycetaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Streptomyces lydicus PA-5726 | 1883 | Streptomycetaceae | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| O43451 | Maltase-glucoamylase, intestinal | Hydrolase | CHEMBL120638 | CHEMBL683913
                        (1) | 0 / 0 |