| id | C00017872 |
|---|---|
| Name | Tautomycin |
| CAS RN | 109946-35-2 |
| Standard InChI | InChI=1S/C41H66O13/c1-21(2)36(51-34(47)20-31(45)35-27(8)39(48)52-40(35)49)38(50-10)32(46)19-30(44)26(7)29(43)13-11-24(5)37-25(6)16-18-41(54-37)17-15-23(4)33(53-41)14-12-22(3)28(9)42/h21-26,29,31-33,36-38,43,45-46H,11-20H2,1-10H3/t22-,23+,24+,25-,26-,29-,31+,32+,33-,36+,37-,38-,41+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C41H66O13/c1-21(2)36(51-34(47)20-31(45)35-27(8)39(48)52-40(35)49)38(50-10)32(46)19-30(44)26(7)29(43)13-11-24(5)37-25(6)16-18-41(54-37)17-15-23(4)33(53-41)14-12-22(3)28(9)42/h21-26,29,31-33,36-38,43,45-46H,11-20H2,1-10H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8274 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL40248 CHEMBL505512 |
| By LinkDB | C05372 |
|---|
| By CAS RN | C053079 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. | 1931 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL505512 |
CHEMBL857419
(1)
|
0 / 0 |
| Q15257 | Serine/threonine-protein phosphatase 2A activator | Protein phosphatase regulatory subunit | CHEMBL40248 CHEMBL505512 |
CHEMBL768164
(2)
|
0 / 0 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C053079 | 598 |
BCL2L1
BCL-XL/S BCL2L BCLX BCLXL BCLXS Bcl-X PPP1R52 bcl-xL bcl-xS |
BCL2-like 1 | tautomycin inhibits the reaction [[Ibuprofen co-treated with epigallocatechin gallate] results in decreased expression of BCL2L1 mRNA alternative form] |
affects cotreatment
/ decreases expression / decreases reaction |
mRNA |
18348186
|
| C053079 | 598 |
BCL2L1
BCL-XL/S BCL2L BCLX BCLXL BCLXS Bcl-X PPP1R52 bcl-xL bcl-xS |
BCL2-like 1 | tautomycin inhibits the reaction [[Ibuprofen co-treated with epigallocatechin gallate] results in increased expression of BCL2L1 mRNA alternative form] |
affects cotreatment
/ decreases reaction / increases expression |
mRNA |
18348186
|
| C053079 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | tautomycin inhibits the reaction [Docosahexaenoic Acids results in increased cleavage of and results in increased activity of CASP3 protein] |
decreases reaction
/ increases activity / increases cleavage |
protein |
11341974
|
| C053079 | 4170 |
MCL1
BCL2L3 EAT MCL1-ES MCL1L MCL1S Mcl-1 TM bcl2-L-3 mcl1/EAT |
myeloid cell leukemia sequence 1 (BCL2-related) | tautomycin inhibits the reaction [[Ibuprofen co-treated with epigallocatechin gallate] results in decreased expression of MCL1 mRNA alternative form] |
affects cotreatment
/ decreases expression / decreases reaction |
mRNA |
18348186
|
| C053079 | 4170 |
MCL1
BCL2L3 EAT MCL1-ES MCL1L MCL1S Mcl-1 TM bcl2-L-3 mcl1/EAT |
myeloid cell leukemia sequence 1 (BCL2-related) | tautomycin inhibits the reaction [[Ibuprofen co-treated with epigallocatechin gallate] results in increased expression of MCL1 mRNA alternative form] |
affects cotreatment
/ decreases reaction / increases expression |
mRNA |
18348186
|
| C053079 | 142 |
PARP1
ADPRT ADPRT_1 ADPRT1 ARTD1 PARP PARP-1 PPOL pADPRT-1 |
poly (ADP-ribose) polymerase 1 (EC:2.4.2.30) | tautomycin inhibits the reaction [Docosahexaenoic Acids results in increased degradation of PARP1 protein] |
decreases reaction
/ increases degradation |
protein |
11341974
|