| id | C00001797 |
|---|---|
| Name | Alangimarine |
| CAS RN | 77156-16-2 |
| Standard InChI | InChI=1S/C19H16N2O3/c1-3-11-9-20-10-15-13(11)7-16-14-8-17(22)18(24-2)6-12(14)4-5-21(16)19(15)23/h3,6-10,22H,1,4-5H2,2H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H16N2O3/c1-3-11-9-20-10-15-13(11)7-16-14-8-17(22)18(24-2)6-12(14)4-5-21(16)19(15)23/h3,6-10,22H,1,4-5H2,2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2972 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB | C09329 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alangium lamarckii | 16896 | Cornaceae | asterids | Viridiplantae |