id | C00018203 |
---|---|
Name | Frenolicin B |
CAS RN | 68930-68-7 |
Standard InChI | InChI=1S/C18H16O6/c1-2-4-10-14-15(18-11(23-10)7-12(20)24-18)16(21)8-5-3-6-9(19)13(8)17(14)22/h3,5-6,10-11,18-19H,2,4,7H2,1H3/t10-,11-,18+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C18H16O6/c1-2-4-10-14-15(18-11(23-10)7-12(20)24-18)16(21)8-5-3-6-9(19)13(8)17(14)22/h3,5-6,10-11,18-19H,2,4,7H2,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1191 |
By standard InChI | CHEMBL474390 |
---|---|
By standard InChI Main Layer | CHEMBL474390 |
By LinkDB |
---|
By CAS RN | C018066 |
---|
class name | count |
---|
family name | count |
---|---|
Streptomycetaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Streptomyces fradiae AM-3867 | 1883 | Streptomycetaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P31749 | RAC-alpha serine/threonine-protein kinase | Akt | CHEMBL474390 |
CHEMBL1018804
(1)
CHEMBL2217254
(1)
|
4 / 1 |