| id | C00018204 | 
|---|---|
| Name | Deoxyfrenolicin | 
| CAS RN | 10023-11-7 | 
| Standard InChI | InChI=1S/C18H18O6/c1-2-4-13-16-11(7-9(24-13)8-14(20)21)17(22)10-5-3-6-12(19)15(10)18(16)23/h3,5-6,9,13,19H,2,4,7-8H2,1H3,(H,20,21)/t9-,13+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C18H18O6/c1-2-4-13-16-11(7-9(24-13)8-14(20)21)17(22)10-5-3-6-12(19)15(10)18(16)23/h3,5-6,9,13,19H,2,4,7-8H2,1H3,(H,20,21) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1191 | 
| By standard InChI | CHEMBL444165 | 
|---|---|
| By standard InChI Main Layer | CHEMBL444165 | 
| By LinkDB | 
|---|
| By CAS RN | C004673 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Streptomycetaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Streptomyces fradiae AM-3867 | 1883 | Streptomycetaceae | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P31749 | RAC-alpha serine/threonine-protein kinase | Akt | CHEMBL444165 | CHEMBL1018804
                        (1)
                        CHEMBL1019647
                        (1) | 4 / 1 |