| id | C00001849 |
|---|---|
| Name | Emetine |
| CAS RN | 483-18-1 |
| Standard InChI | InChI=1S/C29H40N2O4/c1-6-18-17-31-10-8-20-14-27(33-3)29(35-5)16-23(20)25(31)12-21(18)11-24-22-15-28(34-4)26(32-2)13-19(22)7-9-30-24/h13-16,18,21,24-25,30H,6-12,17H2,1-5H3/t18-,21-,24+,25-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C29H40N2O4/c1-6-18-17-31-10-8-20-14-27(33-3)29(35-5)16-23(20)25(31)12-21(18)11-24-22-15-28(34-4)26(32-2)13-19(22)7-9-30-24/h13-16,18,21,24-25,30H,6-12,17H2,1-5H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 510 |
| By standard InChI | CHEMBL50588 |
|---|---|
| By standard InChI Main Layer | CHEMBL50588 CHEMBL192858 CHEMBL1090755 CHEMBL1325269 CHEMBL1435868 CHEMBL1515885 CHEMBL1624688 |
| By LinkDB | C09421 |
|---|
| By CAS RN | D004640 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alangium longiflorum | 616982 | Cornaceae | asterids | Viridiplantae |
| Cephaelis acuminata | 77880 | Rubiaceae | asterids | Viridiplantae |
| Cephaelis ipecacuanha | 77880 | Rubiaceae | asterids | Viridiplantae |
| Cephalis acuminata | ||||
| Cephalis ipecacuanha |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL50588 CHEMBL1435868 CHEMBL1515885 |
CHEMBL1741321
(2)
CHEMBL1909136
(2)
|
1 / 0 |
| P42345 | Serine/threonine-protein kinase mTOR | Enzyme | CHEMBL50588 |
CHEMBL1613805
(1)
CHEMBL1614009
(1)
|
0 / 0 |
| P04637 | Cellular tumor antigen p53 | Transcription Factor | CHEMBL1435868 |
CHEMBL1613992
(1)
|
7 / 44 |
| Q16637 | Survival motor neuron protein | Unclassified protein | CHEMBL1515885 |
CHEMBL1613842
(1)
|
4 / 2 |
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL50588 CHEMBL1515885 |
CHEMBL1794367
(1)
CHEMBL2114784
(2)
|
1 / 1 |
| P21728 | D(1A) dopamine receptor | Dopamine receptor | CHEMBL50588 |
CHEMBL1909139
(2)
|
0 / 0 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL50588 |
CHEMBL1909131
(2)
|
0 / 3 |
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL50588 |
CHEMBL1909190
(2)
|
2 / 2 |
| P08246 | Neutrophil elastase | S1A | CHEMBL50588 |
CHEMBL1909195
(2)
|
2 / 1 |
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL50588 |
CHEMBL1909215
(2)
|
0 / 0 |
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL50588 |
CHEMBL1909201
(2)
|
0 / 0 |
| P49146 | Neuropeptide Y receptor type 2 | Neuropeptide Y receptor | CHEMBL50588 |
CHEMBL1909176
(2)
|
0 / 0 |
| P29466 | Caspase-1 | C14 | CHEMBL50588 |
CHEMBL1909193
(2)
|
0 / 0 |
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL50588 |
CHEMBL1909198
(2)
|
0 / 0 |
| P27361 | Mitogen-activated protein kinase 3 | Erk | CHEMBL50588 |
CHEMBL1909199
(2)
|
0 / 0 |
| P14780 | Matrix metalloproteinase-9 | M10A | CHEMBL50588 |
CHEMBL1909197
(2)
|
2 / 2 |
| O75604 | Ubiquitin carboxyl-terminal hydrolase 2 | Enzyme | CHEMBL1515885 |
CHEMBL1614331
(1)
|
0 / 0 |
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL50588 CHEMBL1515885 |
CHEMBL1614544
(2)
|
11 / 10 |
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL50588 |
CHEMBL1909123
(2)
|
1 / 2 |
| P07550 | Beta-2 adrenergic receptor | Adrenergic receptor | CHEMBL50588 |
CHEMBL1909092
(2)
|
0 / 1 |
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL50588 |
CHEMBL1909169
(2)
|
1 / 1 |
| P25021 | Histamine H2 receptor | Histamine receptor | CHEMBL50588 |
CHEMBL1909157
(2)
|
0 / 0 |
| P35367 | Histamine H1 receptor | Histamine receptor | CHEMBL50588 |
CHEMBL1909156
(2)
|
0 / 0 |
| Q01959 | Sodium-dependent dopamine transporter | Dopamine | CHEMBL50588 |
CHEMBL1909143
(2)
|
1 / 0 |
| P08912 | Muscarinic acetylcholine receptor M5 | Acetylcholine receptor | CHEMBL50588 |
CHEMBL1909174
(2)
|
0 / 0 |
| P18825 | Alpha-2C adrenergic receptor | Adrenergic receptor | CHEMBL50588 |
CHEMBL1909090
(2)
|
0 / 0 |
| P13945 | Beta-3 adrenergic receptor | Adrenergic receptor | CHEMBL50588 |
CHEMBL1909093
(2)
|
0 / 0 |
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL50588 |
CHEMBL1908285
(1)
CHEMBL1908286
(1)
CHEMBL1908289 (1) CHEMBL1908291 (1) CHEMBL1908292 (1) CHEMBL2075835 (1) CHEMBL2076208 (1) CHEMBL2076213 (1) CHEMBL2076214 (1) CHEMBL2076217 (1) CHEMBL2076218 (1) CHEMBL2076250 (1) CHEMBL2078544 (1) CHEMBL2078545 (1) CHEMBL2078546 (1) CHEMBL2078547 (1) |
1 / 0 |
| P25024 | C-X-C chemokine receptor type 1 | CXC chemokine receptor | CHEMBL50588 |
CHEMBL1909127
(2)
|
0 / 0 |
| P06241 | Tyrosine-protein kinase Fyn | Src | CHEMBL50588 |
CHEMBL1909204
(2)
|
0 / 0 |
| Q08209 | Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform | Ser_Thr | CHEMBL50588 |
CHEMBL1909202
(2)
|
0 / 0 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL50588 CHEMBL1435868 CHEMBL1515885 |
CHEMBL1741325
(2)
CHEMBL1909135
(2)
|
0 / 1 |
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL50588 |
CHEMBL1909203
(2)
|
1 / 11 |
| P14416 | D(2) dopamine receptor | Dopamine receptor | CHEMBL50588 |
CHEMBL1909140
(2)
|
2 / 0 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL50588 |
CHEMBL1909130
(2)
|
0 / 0 |
| P37288 | Vasopressin V1a receptor | Vasopressin and oxytocin receptor | CHEMBL50588 |
CHEMBL1909120
(2)
|
0 / 0 |
| P41145 | Kappa-type opioid receptor | Opioid receptor | CHEMBL50588 |
CHEMBL1909181
(2)
|
0 / 0 |
| Q9Y271 | Cysteinyl leukotriene receptor 1 | Leukotriene receptor | CHEMBL50588 |
CHEMBL1909164
(2)
|
0 / 0 |
| P20701 | Integrin alpha-L | Membrane receptor | CHEMBL50588 |
CHEMBL982328
(1)
CHEMBL982330
(1)
|
0 / 0 |
| P29274 | Adenosine receptor A2a | Adenosine receptor | CHEMBL50588 |
CHEMBL1909214
(2)
|
0 / 0 |
| P25929 | Neuropeptide Y receptor type 1 | Neuropeptide Y receptor | CHEMBL50588 |
CHEMBL1909175
(2)
|
0 / 0 |
| P50052 | Type-2 angiotensin II receptor | Angiotensin receptor | CHEMBL50588 |
CHEMBL1909096
(2)
|
1 / 1 |
| O15296 | Arachidonate 15-lipoxygenase B | Enzyme | CHEMBL50588 CHEMBL1325269 CHEMBL1435868 |
CHEMBL1613800
(3)
|
0 / 0 |
| P17948 | Vascular endothelial growth factor receptor 1 | Vegfr | CHEMBL50588 |
CHEMBL1909118
(2)
|
0 / 0 |
| P41968 | Melanocortin receptor 3 | Melanocortin receptor | CHEMBL50588 |
CHEMBL1909166
(2)
|
1 / 0 |
| P11509 | Cytochrome P450 2A6 | Cytochrome P450 2A6 | CHEMBL50588 |
CHEMBL1909133
(2)
|
0 / 0 |
| Q16665 | Hypoxia-inducible factor 1-alpha | Transcription Factor | CHEMBL50588 CHEMBL1435868 CHEMBL1515885 |
CHEMBL999906
(1)
CHEMBL999907
(1)
CHEMBL999922 (1) CHEMBL999923 (1) CHEMBL1614456 (2) CHEMBL1613803 (2) |
0 / 0 |
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL50588 |
CHEMBL1794486
(1)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1515885 |
CHEMBL1738606
(1)
|
0 / 0 |
| P42858 | Huntingtin | Unclassified protein | CHEMBL50588 |
CHEMBL1613918
(1)
|
1 / 1 |
| O75496 | Geminin | Unclassified protein | CHEMBL50588 |
CHEMBL2114780
(1)
|
0 / 0 |
| P51151 | Ras-related protein Rab-9A | Unclassified protein | CHEMBL50588 |
CHEMBL1613838
(1)
|
0 / 0 |
| O75884 | Putative hydrolase RBBP9 | Enzyme | CHEMBL50588 |
CHEMBL1114312
(1)
CHEMBL1114313
(1)
CHEMBL1115107 (1) CHEMBL1115108 (1) |
0 / 0 |
| P04035 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | Oxidoreductase | CHEMBL50588 |
CHEMBL1909158
(2)
|
0 / 0 |
| P08913 | Alpha-2A adrenergic receptor | Adrenergic receptor | CHEMBL50588 |
CHEMBL1909088
(2)
|
0 / 0 |
| P21917 | D(4) dopamine receptor | Dopamine receptor | CHEMBL50588 |
CHEMBL1909142
(2)
|
0 / 0 |
| P30988 | Calcitonin receptor | Calcitonin receptor | CHEMBL50588 |
CHEMBL1909101
(2)
|
0 / 0 |
| P35462 | D(3) dopamine receptor | Dopamine receptor | CHEMBL50588 |
CHEMBL1909141
(2)
|
1 / 0 |
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL50588 |
CHEMBL1909180
(2)
|
0 / 0 |
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL50588 |
CHEMBL1909146
(2)
|
0 / 1 |
| P41595 | 5-hydroxytryptamine receptor 2B | Serotonin receptor | CHEMBL50588 |
CHEMBL1909104
(2)
|
0 / 0 |
| P25101 | Endothelin-1 receptor | Endothelin receptor | CHEMBL50588 |
CHEMBL1909144
(2)
|
0 / 0 |
| P30411 | B2 bradykinin receptor | Bradykinin receptor | CHEMBL50588 |
CHEMBL1909100
(2)
|
0 / 0 |
| P32245 | Melanocortin receptor 4 | Melanocortin receptor | CHEMBL50588 |
CHEMBL1909167
(2)
|
1 / 0 |
| P32238 | Cholecystokinin receptor type A | Cholecystokinin receptor | CHEMBL50588 |
CHEMBL1909129
(2)
|
0 / 0 |
| P08311 | Cathepsin G | S1A | CHEMBL50588 |
CHEMBL1909194
(2)
|
0 / 0 |
| Q99720 | Sigma non-opioid intracellular receptor 1 | Membrane receptor | CHEMBL50588 |
CHEMBL1909110
(2)
|
1 / 0 |
| P03956 | Interstitial collagenase | M10A | CHEMBL50588 |
CHEMBL1909196
(2)
|
0 / 1 |
| P32241 | Vasoactive intestinal polypeptide receptor 1 | Vasoactive intestinal peptide receptor | CHEMBL50588 |
CHEMBL1909119
(2)
|
0 / 0 |
| P42226 | Signal transducer and activator of transcription 6 | Unclassified protein | CHEMBL1435868 |
CHEMBL1614338
(1)
CHEMBL1614070
(1)
|
0 / 0 |
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL50588 |
CHEMBL1909150
(2)
|
0 / 1 |
| P08172 | Muscarinic acetylcholine receptor M2 | Acetylcholine receptor | CHEMBL50588 |
CHEMBL1909171
(2)
|
2 / 0 |
| P11229 | Muscarinic acetylcholine receptor M1 | Acetylcholine receptor | CHEMBL50588 |
CHEMBL1909170
(2)
|
0 / 0 |
| P21554 | Cannabinoid receptor 1 | Cannabinoid receptor | CHEMBL50588 |
CHEMBL1909122
(2)
|
0 / 0 |
| P31645 | Sodium-dependent serotonin transporter | Serotonin | CHEMBL50588 |
CHEMBL1909109
(2)
|
2 / 0 |
| P04626 | Receptor tyrosine-protein kinase erbB-2 | TK tyrosine-protein kinase EGFR subfamily | CHEMBL50588 |
CHEMBL1909205
(2)
|
5 / 10 |
| P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL50588 |
CHEMBL1909172
(2)
|
1 / 0 |
| P21452 | Substance-K receptor | Neurokinin receptor | CHEMBL50588 |
CHEMBL1909114
(2)
|
0 / 0 |
| P51679 | C-C chemokine receptor type 4 | CC chemokine receptor | CHEMBL50588 |
CHEMBL1909125
(2)
|
0 / 0 |
| P51681 | C-C chemokine receptor type 5 | CC chemokine receptor | CHEMBL50588 |
CHEMBL1909126
(2)
|
3 / 0 |
| P50406 | 5-hydroxytryptamine receptor 6 | Serotonin receptor | CHEMBL50588 |
CHEMBL1909108
(2)
|
0 / 0 |
| P41597 | C-C chemokine receptor type 2 | CC chemokine receptor | CHEMBL50588 |
CHEMBL1909124
(2)
|
1 / 0 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL50588 CHEMBL1325269 CHEMBL1435868 |
CHEMBL1613808
(2)
CHEMBL1909200
(2)
|
0 / 0 |
| P08575 | Receptor-type tyrosine-protein phosphatase C | Enzyme | CHEMBL50588 |
CHEMBL1909207
(2)
|
2 / 1 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL50588 CHEMBL1435868 CHEMBL1515885 |
CHEMBL1741322
(2)
CHEMBL1909132
(2)
|
0 / 0 |
| P27540 | Aryl hydrocarbon receptor nuclear translocator | Unclassified protein | CHEMBL50588 |
CHEMBL999908
(1)
CHEMBL999909
(1)
|
0 / 0 |
| O15118 | Niemann-Pick C1 protein | Unclassified protein | CHEMBL50588 |
CHEMBL1614342
(1)
|
1 / 1 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL50588 |
CHEMBL1738675
(1)
CHEMBL1737868
(1)
|
0 / 0 |
| O76074 | cGMP-specific 3',5'-cyclic phosphodiesterase | PDE_5A | CHEMBL50588 |
CHEMBL1909186
(2)
|
0 / 0 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL50588 |
CHEMBL1909145
(2)
|
1 / 1 |
| P08588 | Beta-1 adrenergic receptor | Adrenergic receptor | CHEMBL50588 |
CHEMBL1909091
(2)
|
1 / 0 |
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL50588 |
CHEMBL1909212
(2)
|
1 / 0 |
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL50588 |
CHEMBL1909211
(2)
|
0 / 0 |
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL50588 |
CHEMBL1909105
(2)
|
0 / 0 |
| P35372 | Mu-type opioid receptor | Opioid receptor | CHEMBL50588 |
CHEMBL1909182
(2)
|
0 / 0 |
| P08173 | Muscarinic acetylcholine receptor M4 | Acetylcholine receptor | CHEMBL50588 |
CHEMBL1909173
(2)
|
0 / 0 |
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL50588 |
CHEMBL1909113
(2)
|
0 / 0 |
| P25105 | Platelet-activating factor receptor | PAF receptor | CHEMBL50588 |
CHEMBL1909187
(2)
|
0 / 0 |
| P33032 | Melanocortin receptor 5 | Melanocortin receptor | CHEMBL50588 |
CHEMBL1909168
(2)
|
0 / 0 |
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL1435868 |
CHEMBL1614274
(1)
CHEMBL1613823
(1)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL50588 CHEMBL1435868 CHEMBL1515885 |
CHEMBL1741323
(2)
CHEMBL1909134
(2)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL50588 CHEMBL1325269 CHEMBL1435868 CHEMBL1515885 |
CHEMBL1614108
(2)
CHEMBL1613886
(2)
CHEMBL1741324 (2) CHEMBL1909138 (2) |
0 / 1 |
| P05181 | Cytochrome P450 2E1 | Cytochrome P450 2E1 | CHEMBL50588 |
CHEMBL1909137
(2)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL50588 |
CHEMBL1614250
(1)
|
4 / 3 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL50588 |
CHEMBL1737980
(1)
|
0 / 0 |
| P23975 | Sodium-dependent noradrenaline transporter | Norepinephrine | CHEMBL50588 |
CHEMBL1909094
(2)
|
1 / 1 |
| P25100 | Alpha-1D adrenergic receptor | Adrenergic receptor | CHEMBL50588 |
CHEMBL1909087
(2)
|
0 / 0 |
| P30542 | Adenosine receptor A1 | Adenosine receptor | CHEMBL50588 |
CHEMBL1909213
(2)
|
0 / 0 |
| P18089 | Alpha-2B adrenergic receptor | Adrenergic receptor | CHEMBL50588 |
CHEMBL1909089
(2)
|
0 / 0 |
| P24557 | Thromboxane-A synthase | Cytochrome P450 5A1 | CHEMBL50588 |
CHEMBL1909116
(2)
|
1 / 1 |
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL50588 |
CHEMBL1909206
(2)
|
0 / 1 |
| P25025 | C-X-C chemokine receptor type 2 | CXC chemokine receptor | CHEMBL50588 |
CHEMBL1909128
(2)
|
0 / 0 |
| P40225 | Thrombopoietin | Unclassified protein | CHEMBL1435868 |
CHEMBL1614086
(1)
CHEMBL1614034
(1)
|
1 / 1 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL50588 |
CHEMBL1738442
(1)
|
0 / 0 |
| O00255 | Menin | Unclassified protein | CHEMBL50588 CHEMBL1325269 CHEMBL1515885 |
CHEMBL1614257
(3)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL50588 CHEMBL1325269 CHEMBL1515885 |
CHEMBL1614257
(3)
|
1 / 3 |
| O76082 | Solute carrier family 22 member 5 | Unclassified protein | CHEMBL50588 |
CHEMBL2078122
(1)
|
1 / 2 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| D004640 | 10142 |
AKAP9
AKAP-9 AKAP350 AKAP450 CG-NAP HYPERION LQT11 MU-RMS-40.16A PPP1R45 PRKA9 YOTIAO |
A kinase (PRKA) anchor protein 9 | Emetine inhibits the reaction [sodium arsenite affects the localization of AKAP9 protein] |
affects localization
/ decreases reaction |
protein |
19073175
|
| D004640 | 4076 |
CAPRIN1
GPIAP1 GPIP137 M11S1 RNG105 p137GPI |
cell cycle associated protein 1 | Emetine inhibits the reaction [sodium arsenite affects the localization of CAPRIN1 protein] |
affects localization
/ decreases reaction |
protein |
19073175
|
| D004640 | 55749 |
CCAR1
RP11-437A18.1 |
cell division cycle and apoptosis regulator 1 | Emetine inhibits the reaction [sodium arsenite affects the localization of CCAR1 protein] |
affects localization
/ decreases reaction |
protein |
19073175
|
| D004640 | 6347 |
CCL2
GDCF-2 HC11 HSMCR30 MCAF MCP-1 MCP1 SCYA2 SMC-CF |
chemokine (C-C motif) ligand 2 | Emetine results in decreased expression of CCL2 protein |
decreases expression
|
protein |
20116850
|
| D004640 | 6348 |
CCL3
G0S19-1 LD78ALPHA MIP-1-alpha MIP1A SCYA3 |
chemokine (C-C motif) ligand 3 | Emetine results in decreased expression of CCL3 protein |
decreases expression
|
protein |
20116850
|
| D004640 | 6351 |
CCL4
ACT2 AT744.1 G-26 HC21 LAG-1 LAG1 MIP-1-beta MIP1B MIP1B1 SCYA2 SCYA4 |
chemokine (C-C motif) ligand 4 | Emetine results in decreased expression of CCL4 protein |
decreases expression
|
protein |
20116850
|
| D004640 | 6352 |
CCL5
D17S136E RANTES SCYA5 SIS-delta SISd TCP228 eoCP |
chemokine (C-C motif) ligand 5 | Emetine results in decreased expression of CCL5 protein |
decreases expression
|
protein |
20116850
|
| D004640 | 3570 |
IL6R
CD126 IL-6R-1 IL-6RA IL6Q IL6RA IL6RQ gp80 |
interleukin 6 receptor | Emetine results in decreased expression of IL6R protein modified form |
decreases expression
|
protein |
20116850
|
| D004640 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | Emetine results in decreased expression of IL8 protein |
decreases expression
|
protein |
20116850
|
| D004640 | 1432 |
MAPK14
CSBP CSBP1 CSBP2 CSPB1 EXIP Mxi2 PRKM14 PRKM15 RK SAPK2A p38 p38ALPHA |
mitogen-activated protein kinase 14 (EC:2.7.11.24) | Emetine results in increased phosphorylation of and results in increased activity of MAPK14 protein |
increases activity
/ increases phosphorylation |
protein |
16364386
|
| D004640 | 4137 |
MAPT
DDPAC FTDP-17 MAPTL MSTD MTBT1 MTBT2 PPND TAU |
microtubule-associated protein tau | Emetine results in decreased expression of MAPT protein |
decreases expression
|
protein |
16930453
|
| D004640 | 142 |
PARP1
ADPRT ADPRT_1 ADPRT1 ARTD1 PARP PARP-1 PPOL pADPRT-1 |
poly (ADP-ribose) polymerase 1 (EC:2.4.2.30) | Emetine results in increased cleavage of PARP1 protein |
increases cleavage
|
protein |
21256112
|
| D004640 | 7422 |
VEGFA
MVCD1 VEGF VPF |
vascular endothelial growth factor A | Emetine results in decreased expression of VEGFA protein |
decreases expression
|
protein |
20116850
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism |
P20309
|
| #202300 | Adrenocortical carcinoma, hereditary; adcc |
P04637
|
| #103780 | Alcohol dependence |
P08172
P14416 P31645 |
| #614373 | Amyotrophic lateral sclerosis 16, juvenile; als16 |
Q99720
|
| #614740 | Basal cell carcinoma, susceptibility to, 7; bcc7 |
P04637
|
| #602025 | Body mass index quantitative trait locus 9; bmiq9 |
P41968
|
| #300615 | Brunner syndrome |
P21397
|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a |
P02545
|
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism |
P02545
|
| #212140 | Carnitine deficiency, systemic primary; cdsp |
O76082
|
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 |
P02545
|
| #162800 | Cyclic neutropenia |
P08246
|
| #612522 | Diabetes mellitus, insulin-dependent, 22; iddm22 |
P51681
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 |
P02545
|
| #133239 | Esophageal cancer |
P04637
|
| #615363 | Estrogen resistance; estrr |
P03372
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #613659 | Gastric cancer |
P04626
|
| #137215 | Gastric cancer, hereditary diffuse; hdgc |
P04626
|
| #231095 | Ghosal hematodiaphyseal dysplasia; ghdd |
P24557
|
| #137800 | Glioma susceptibility 1; glm1 |
P04626
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #610140 | Heart-hand syndrome, slovenian type |
P02545
|
| #609423 | Human immunodeficiency virus type 1, susceptibility to |
P41597
P51681 |
| #143100 | Huntington disease; hd |
P42858
|
| #176670 | Hutchinson-gilford progeria syndrome; hgps |
P02545
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #612244 | Inflammatory bowel disease 13; ibd13 |
P08183
|
| #603932 | Intervertebral disc disease; idd |
P14780
|
| #151623 | Li-fraumeni syndrome 1; lfs1 |
P04637
|
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 |
P02545
|
| #613688 | Long qt syndrome 2; lqt2 |
Q12809
|
| #211980 | Lung cancer |
P00533
P04626 P04637 |
| #608516 | Major depressive disorder; mdd |
P08172
|
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada |
P02545
|
| %300852 | Mental retardation, x-linked 88; mrx88 |
P50052
|
| #613073 | Metaphyseal anadysplasia 2; mandp2 |
P14780
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #126200 | Multiple sclerosis, susceptibility to; ms |
P08575
|
| #613205 | Muscular dystrophy, congenital, lmna-related |
P02545
|
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b |
P02545
|
| #159900 | Myoclonic dystonia |
P14416
|
| #202700 | Neutropenia, severe congenital, 1, autosomal dominant; scn1 |
P08246
|
| #257220 | Niemann-pick disease, type c1; npc1 |
O15118
|
| #601665 | Obesity |
P32245
|
| #164230 | Obsessive-compulsive disorder; ocd |
P31645
|
| #604715 | Orthostatic intolerance |
P23975
|
| #259730 | Osteopetrosis, autosomal recessive 3; optb3 |
P00918
|
| #167000 | Ovarian cancer |
P04626
|
| #260500 | Papilloma of choroid plexus; cpp |
P04637
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #613135 | Parkinsonism-dystonia, infantile; pkdys |
Q01959
|
| #172700 | Pick disease of brain |
P10636
|
| #607276 | Resting heart rate, variation in |
P08588
|
| #275210 | Restrictive dermopathy, lethal |
P02545
|
| #608971 | Severe combined immunodeficiency, autosomal recessive, t cell-negative, b cell-positive, nk cell-positive |
P08575
|
| #609620 | Short qt syndrome 1; sqt1 |
Q12809
|
| #253300 | Spinal muscular atrophy, type i; sma1 |
Q16637
|
| #253550 | Spinal muscular atrophy, type ii; sma2 |
Q16637
|
| #253400 | Spinal muscular atrophy, type iii; sma3 |
Q16637
|
| #271150 | Spinal muscular atrophy, type iv; sma4 |
Q16637
|
| #183090 | Spinocerebellar ataxia 2; sca2 |
Q99700
|
| #275355 | Squamous cell carcinoma, head and neck; hnscc |
P04637
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| #187950 | Thrombocythemia 1; thcyt1 |
P40225
|
| #190300 | Tremor, hereditary essential, 1; etm1 |
P35462
|
| #610379 | West nile virus, susceptibility to |
P51681
|
| #112100 | Yt blood group antigen |
P22303
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
P04637 (related) |
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00136 | Niemann-Pick disease type C (NPC) |
O15118
(related)
|
| H00286 | Crohn's disease |
O76082
(related)
|
| H00525 | Disorders of fatty-acid oxidation |
O76082
(related)
|
| H00016 | Oral cancer |
P00533
(related)
P00533 (marker) P04637 (related) P04637 (marker) |
| H00017 | Esophageal cancer |
P00533
(related)
P04637 (related) P04637 (marker) P35354 (related) |
| H00018 | Gastric cancer |
P00533
(related)
P04626 (related) P04637 (related) |
| H00022 | Bladder cancer |
P00533
(related)
P04626 (related) P04637 (related) |
| H00028 | Choriocarcinoma |
P00533
(related)
P03956 (related) P04626 (related) P04637 (related) |
| H00030 | Cervical cancer |
P00533
(related)
P04626 (related) |
| H00042 | Glioma |
P00533
(related)
P00533 (marker) P04637 (related) P04637 (marker) |
| H00055 | Laryngeal cancer |
P00533
(related)
P00533 (marker) P04637 (related) P04637 (marker) |
| H00241 | Combined proximal and distal renal tubular acidosis (RTA type 3) |
P00918
(related)
|
| H00436 | Osteopetrosis |
P00918
(related)
|
| H00264 | Charcot-Marie-Tooth disease (CMT) |
P02545
(related)
|
| H00294 | Dilated cardiomyopathy (DCM) |
P02545
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P02545
(related)
|
| H00563 | Emery-Dreifuss muscular dystrophy |
P02545
(related)
|
| H00590 | Congenital muscular dystrophies (CMD/MDC) |
P02545
(related)
|
| H00593 | Limb-girdle muscular dystrophy (LGMD) |
P02545
(related)
|
| H00601 | Hutchinson-Gilford progeria syndrome |
P02545
(related)
|
| H00663 | Restrictive dermopathy |
P02545
(related)
|
| H00665 | Mandibuloacral dysplasia |
P02545
(related)
|
| H01216 | Left ventricular noncompaction (LVNC) |
P02545
(related)
|
| H00026 | Endometrial Cancer |
P03372
(marker)
P04626 (related) P04637 (related) Q92731 (marker) |
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) |
P04150
(related)
|
| H00019 | Pancreatic cancer |
P04626
(related)
P04637 (related) P04637 (marker) |
| H00027 | Ovarian cancer |
P04626
(related)
P04637 (related) |
| H00031 | Breast cancer |
P04626
(related)
P04626 (marker) P04637 (related) |
| H00046 | Cholangiocarcinoma |
P04626
(related)
P04637 (related) P35354 (related) |
| H00004 | Chronic myeloid leukemia (CML) |
P04637
(related)
|
| H00005 | Chronic lymphocytic leukemia (CLL) |
P04637
(related)
|
| H00006 | Hairy-cell leukemia |
P04637
(related)
|
| H00008 | Burkitt lymphoma |
P04637
(related)
|
| H00009 | Adult T-cell leukemia |
P04637
(related)
|
| H00010 | Multiple myeloma |
P04637
(related)
|
| H00013 | Small cell lung cancer |
P04637
(related)
|
| H00014 | Non-small cell lung cancer |
P04637
(related)
|
| H00015 | Malignant pleural mesothelioma |
P04637
(related)
|
| H00020 | Colorectal cancer |
P04637
(related)
P04637 (marker) |
| H00025 | Penile cancer |
P04637
(related)
P04637 (marker) P14780 (related) P35354 (related) |
| H00029 | Vulvar cancer |
P04637
(related)
|
| H00032 | Thyroid cancer |
P04637
(related)
|
| H00036 | Osteosarcoma |
P04637
(related)
P08684 (marker) |
| H00038 | Malignant melanoma |
P04637
(related)
|
| H00039 | Basal cell carcinoma |
P04637
(related)
|
| H00040 | Squamous cell carcinoma |
P04637
(related)
|
| H00041 | Kaposi's sarcoma |
P04637
(related)
|
| H00044 | Cancer of the anal canal |
P04637
(related)
|
| H00047 | Gallbladder cancer |
P04637
(related)
|
| H00048 | Hepatocellular carcinoma |
P04637
(related)
|
| H00881 | Li-Fraumeni syndrome |
P04637
(related)
|
| H01007 | Choroid plexus papilloma |
P04637
(related)
|
| H00021 | Renal cell carcinoma |
P04637
(marker)
|
| H00093 | Combined immunodeficiencies (CIDs) |
P06239
(related)
|
| H00079 | Asthma |
P07550
(related)
|
| H00100 | Neutropenic disorders |
P08246
(related)
|
| H00091 | T-B+Severe combined immunodeficiencies (SCIDs) |
P08575
(related)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00479 | Metaphyseal dysplasias |
P14780
(related)
|
| H00548 | Brunner syndrome |
P21397
(related)
|
| H01031 | Orthostatic intolerance (OI) |
P23975
(related)
|
| H00490 | Diaphyseal dysplasia with anemia (Ghosal) |
P24557
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00227 | Congenital amegakaryocytic thrombocytopenia (CAMT) |
P40225
(marker)
|
| H00059 | Huntington's disease (HD) |
P42858
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
P50052
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|
| H00720 | Long QT syndrome |
Q12809
(related)
|
| H00725 | Short QT syndrome |
Q12809
(related)
|
| H00455 | Spinal muscular atrophy (SMA) |
Q16637
(related)
Q16637 (related) |
| H00063 | Spinocerebellar ataxia (SCA) |
Q99700
(related)
|
| MeSH disease | OMIM | compound | disease name | evidence type |
reference
pmid |
|---|---|---|---|---|---|
| D007022 | D004640 | Hypotension |
marker/mechanism
|
4603136
|
|
| D008101 | D004640 | Liver Abscess, Amebic |
therapeutic
|
4603136
|
|
| D011605 | D004640 | Psychoses, Substance-Induced |
marker/mechanism
|
4603136
|
|
| D014839 | D004640 | Vomiting |
marker/mechanism
|
4603136
|