| id | C00019011 |
|---|---|
| Name | 5,7,4'-Trihydroxy-6,8-dimethylisoflavone |
| CAS RN | 405507-52-0 |
| Standard InChI | InChI=1S/C17H14O5/c1-8-14(19)9(2)17-13(15(8)20)16(21)12(7-22-17)10-3-5-11(18)6-4-10/h3-7,18-20H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O5/c1-8-14(19)9(2)17-13(15(8)20)16(21)12(7-22-17)10-3-5-11(18)6-4-10/h3-7,18-20H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL512579 |
|---|---|
| By standard InChI Main Layer | CHEMBL512579 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Melastomataceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Henriettella fascicularis | 883786 | Melastomataceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL512579 |
CHEMBL1008128
(1)
|
0 / 1 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL512579 |
CHEMBL946607
(1)
|
1 / 1 |