| id | C00019143 |
|---|---|
| Name | 3-Coumarinol / 3-Hydroxycoumarin |
| CAS RN | 939-19-5 |
| Standard InChI | InChI=1S/C9H6O3/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5,10H |
| Standard InChI (Main Layer) | InChI=1S/C9H6O3/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5,10H |
| Phytochemical cluster | No. 25 |
|---|---|
| KCF-S cluster | No. 1030 |
| By standard InChI | CHEMBL150372 |
|---|---|
| By standard InChI Main Layer | CHEMBL150372 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alyxia lucida | ||||
| Melilotus messanensis | 1279044 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q99489 | D-aspartate oxidase | Enzyme | CHEMBL150372 |
CHEMBL2327933
(2)
|
0 / 0 |
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL150372 |
CHEMBL892636
(1)
|
1 / 1 |
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL150372 |
CHEMBL1212359
(1)
|
1 / 2 |
| P14920 | D-amino-acid oxidase | Enzyme | CHEMBL150372 |
CHEMBL2327780
(1)
CHEMBL2327787
(1)
CHEMBL2327788 (1) CHEMBL2327791 (1) CHEMBL2327928 (1) CHEMBL2327931 (2) CHEMBL2327932 (2) |
0 / 0 |
| O43570 | Carbonic anhydrase 12 | Lyase | CHEMBL150372 |
CHEMBL1212361
(1)
|
1 / 2 |
| P15121 | Aldose reductase | Enzyme | CHEMBL150372 |
CHEMBL1260797
(1)
|
0 / 0 |
| P00915 | Carbonic anhydrase 1 | Lyase | CHEMBL150372 |
CHEMBL1212358
(1)
|
0 / 0 |
| Q9GZT4 | Serine racemase | Enzyme | CHEMBL150372 |
CHEMBL2327930
(2)
|
0 / 0 |
| Q16790 | Carbonic anhydrase 9 | Lyase | CHEMBL150372 |
CHEMBL1212360
(1)
|
0 / 1 |
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL150372 |
CHEMBL1614038
(1)
|
2 / 2 |
| Q00796 | Sorbitol dehydrogenase | Enzyme | CHEMBL150372 |
CHEMBL1260799
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #119900 | Digital clubbing, isolated congenital |
P15428
|
| #143860 | Hyperchlorhidrosis, isolated |
O43570
|
| #259100 | Hypertrophic osteoarthropathy, primary, autosomal recessive, 1; phoar1 |
P15428
|
| #259730 | Osteopetrosis, autosomal recessive 3; optb3 |
P00918
|
| #278300 | Xanthinuria, type i |
P47989
|
| KEGG | disease name | UniProt |
|---|---|---|
| H01302 | Hyperchlorhidrosis isolated (HCHLH) |
O43570
(related)
|
| H00021 | Renal cell carcinoma |
O43570
(marker)
Q16790 (marker) |
| H00241 | Combined proximal and distal renal tubular acidosis (RTA type 3) |
P00918
(related)
|
| H00436 | Osteopetrosis |
P00918
(related)
|
| H00457 | Primary hypertrophic osteoarthropathy (PHO) |
P15428
(related)
|
| H01246 | Isolated congenital nail clubbing (ICNC) |
P15428
(related)
|
| H00192 | Xanthinuria |
P47989
(related)
|