| id | C00019236 |
|---|---|
| Name | Mulberrofuran W / 6,3',5'-Trihydroxy-2'-((2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienyl)-2-arylbenzofuran |
| CAS RN | 329319-21-3 |
| Standard InChI | InChI=1S/C29H34O4/c1-19(2)7-5-8-20(3)9-6-10-21(4)11-14-25-26(16-24(31)17-27(25)32)29-15-22-12-13-23(30)18-28(22)33-29/h7,9,11-13,15-18,30-32H,5-6,8,10,14H2,1-4H3/b20-9+,21-11+ |
| Standard InChI (Main Layer) | InChI=1S/C29H34O4/c1-19(2)7-5-8-20(3)9-6-10-21(4)11-14-25-26(16-24(31)17-27(25)32)29-15-22-12-13-23(30)18-28(22)33-29/h7,9,11-13,15-18,30-32H,5-6,8,10,14H2,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 319 |
| By standard InChI | CHEMBL517415 |
|---|---|
| By standard InChI Main Layer | CHEMBL517415 CHEMBL562810 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Morus mongolica | 229049 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL562810 |
CHEMBL1041807
(1)
CHEMBL1041808
(2)
|
0 / 0 |