| id | C00001925 |
|---|---|
| Name | Tiliacorine |
| CAS RN | 27073-72-9 |
| Standard InChI | InChI=1S/C36H36N2O5/c1-37-11-9-22-17-31-32-19-24(22)27(37)15-20-5-7-29(39)25(13-20)26-14-21(6-8-30(26)40-3)16-28-34-23(10-12-38(28)2)18-33(41-4)35(42-31)36(34)43-32/h5-8,13-14,17-19,27-28,39H,9-12,15-16H2,1-4H3/t27-,28-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C36H36N2O5/c1-37-11-9-22-17-31-32-19-24(22)27(37)15-20-5-7-29(39)25(13-20)26-14-21(6-8-30(26)40-3)16-28-34-23(10-12-38(28)2)18-33(41-4)35(42-31)36(34)43-32/h5-8,13-14,17-19,27-28,39H,9-12,15-16H2,1-4H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 10 |
| By standard InChI | CHEMBL2017489 |
|---|---|
| By standard InChI Main Layer | CHEMBL2017489 CHEMBL2017491 |
| By LinkDB | C09667 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| family name | count |
|---|---|
| Menispermaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Tiliacora acuminata | 527509 | Menispermaceae | eudicotyledons | Viridiplantae |
| Tiliacora racemosa | 461640 | Menispermaceae | eudicotyledons | Viridiplantae |