| id | C00019296 |
|---|---|
| Name | Bolusanthol B / 5,7,3',4'-Tetrahydroxy-5-prenylisoflavanone |
| CAS RN | 186796-42-9 |
| Standard InChI | InChI=1S/C20H20O6/c1-10(2)3-4-11-5-12(6-16(23)19(11)24)14-9-26-17-8-13(21)7-15(22)18(17)20(14)25/h3,5-8,14,21-24H,4,9H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O6/c1-10(2)3-4-11-5-12(6-16(23)19(11)24)14-9-26-17-8-13(21)7-15(22)18(17)20(14)25/h3,5-8,14,21-24H,4,9H2,1-2H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 28 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Bolusanthus speciosus | 53838 | Fabaceae | rosids | Viridiplantae |