| id | C00019337 |
|---|---|
| Name | Glyasperin D |
| CAS RN | 142561-10-2 |
| Standard InChI | InChI=1S/C22H26O5/c1-13(2)5-7-17-20(25-3)11-21-18(22(17)26-4)9-14(12-27-21)16-8-6-15(23)10-19(16)24/h5-6,8,10-11,14,23-24H,7,9,12H2,1-4H3/t14-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H26O5/c1-13(2)5-7-17-20(25-3)11-21-18(22(17)26-4)9-14(12-27-21)16-8-6-15(23)10-19(16)24/h5-6,8,10-11,14,23-24H,7,9,12H2,1-4H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 296 |
| By standard InChI | CHEMBL1563332 |
|---|---|
| By standard InChI Main Layer | CHEMBL1563332 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Glycyrrhiza aspera | 74709 | Fabaceae | rosids | Viridiplantae |
| Glycyrrhiza uralensis | 74613 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1563332 |
CHEMBL2114784
(1)
|
1 / 1 |
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL1563332 |
CHEMBL2354282
(1)
|
4 / 2 |
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL1563332 |
CHEMBL1794486
(1)
|
0 / 0 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1563332 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL1563332 |
CHEMBL2114843
(1)
|
0 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1563332 |
CHEMBL2114788
(1)
|
0 / 0 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL1563332 |
CHEMBL1737991
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #114500 | Colorectal cancer; crc |
P84022
|
| #127750 | Dementia, lewy body; dlb |
P37840
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|
| #168601 | Parkinson disease 1, autosomal dominant; park1 |
P37840
|
| #605543 | Parkinson disease 4, autosomal dominant; park4 |
P37840
|
| #168600 | Parkinson disease, late-onset; pd |
P37840
|
| #183090 | Spinocerebellar ataxia 2; sca2 |
Q99700
|