| id | C00001939 |
|---|---|
| Name | Huperzine B |
| CAS RN | 103548-82-9 |
| Standard InChI | InChI=1S/C16H20N2O/c1-10-7-11-8-14-13(4-5-15(19)18-14)16(9-10)12(11)3-2-6-17-16/h4-5,7,11-12,17H,2-3,6,8-9H2,1H3,(H,18,19)/t11-,12+,16+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H20N2O/c1-10-7-11-8-14-13(4-5-15(19)18-14)16(9-10)12(11)3-2-6-17-16/h4-5,7,11-12,17H,2-3,6,8-9H2,1H3,(H,18,19) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1751 |
| By standard InChI | CHEMBL245079 |
|---|---|
| By standard InChI Main Layer | CHEMBL183649 CHEMBL245079 |
| By LinkDB | C09866 |
|---|
| By CAS RN | C053016 |
|---|
| class name | count |
|---|---|
| Embryophyta | 2 |
| family name | count |
|---|---|
| Lycopodiaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Huperzia serrata | 355589 | Lycopodiaceae | Embryophyta | Viridiplantae |
| Lycopodium serratum | 355589 | Lycopodiaceae | Embryophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL245079 |
CHEMBL644120
(1)
CHEMBL684541
(1)
|
1 / 0 |