id | C00001939 |
---|---|
Name | Huperzine B |
CAS RN | 103548-82-9 |
Standard InChI | InChI=1S/C16H20N2O/c1-10-7-11-8-14-13(4-5-15(19)18-14)16(9-10)12(11)3-2-6-17-16/h4-5,7,11-12,17H,2-3,6,8-9H2,1H3,(H,18,19)/t11-,12+,16+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C16H20N2O/c1-10-7-11-8-14-13(4-5-15(19)18-14)16(9-10)12(11)3-2-6-17-16/h4-5,7,11-12,17H,2-3,6,8-9H2,1H3,(H,18,19) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1751 |
By standard InChI | CHEMBL245079 |
---|---|
By standard InChI Main Layer | CHEMBL183649 CHEMBL245079 |
By LinkDB | C09866 |
---|
By CAS RN | C053016 |
---|
class name | count |
---|---|
Embryophyta | 2 |
family name | count |
---|---|
Lycopodiaceae | 2 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Huperzia serrata | 355589 | Lycopodiaceae | Embryophyta | Viridiplantae |
Lycopodium serratum | 355589 | Lycopodiaceae | Embryophyta | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P22303 | Acetylcholinesterase | Hydrolase | CHEMBL245079 |
CHEMBL644120
(1)
CHEMBL684541
(1)
|
1 / 0 |