| id | C00019536 |
|---|---|
| Name | Prostratol C / 7,2'-Dihydroxy-4'-methoxy-5'-prenylisoflavanone |
| CAS RN | 163136-23-0 |
| Standard InChI | InChI=1S/C21H22O5/c1-12(2)4-5-13-8-16(18(23)10-19(13)25-3)17-11-26-20-9-14(22)6-7-15(20)21(17)24/h4,6-10,17,22-23H,5,11H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O5/c1-12(2)4-5-13-8-16(18(23)10-19(13)25-3)17-11-26-20-9-14(22)6-7-15(20)21(17)24/h4,6-10,17,22-23H,5,11H2,1-3H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 28 |
| By standard InChI | CHEMBL1811967 |
|---|---|
| By standard InChI Main Layer | CHEMBL1811967 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sophora prostrata | 76398 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL1811967 |
CHEMBL1816250
(1)
|
0 / 0 |