| id | C00019687 |
|---|---|
| Name | Anhydroleucovorin / 5,10-Methenyltetrahydrofolate |
| CAS RN | 7444-29-3 |
| Standard InChI | InChI=1S/C20H21N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,9,12-13H,5-8H2,(H6-,21,22,23,24,25,28,29,30,31,32,33)/t12-,13+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H21N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,9,12-13H,5-8H2,(H6-,21,22,23,24,25,28,29,30,31,32,33) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1399 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL46521 |
| By LinkDB |
|---|
| By CAS RN | C018092 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Enterobacteriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Escherichia coli | 562 | Enterobacteriaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04818 | Thymidylate synthase | Transferase | CHEMBL46521 |
CHEMBL816057
(1)
|
0 / 0 |
| P11586 | C-1-tetrahydrofolate synthase, cytoplasmic | Enzyme | CHEMBL46521 |
CHEMBL615107
(1)
CHEMBL615114
(1)
|
2 / 1 |