| id | C00019738 |
|---|---|
| Name | Eryvarin K / 3,9-Dihydroxy-8-methoxy-4-prenylpterocarpan |
| CAS RN | 658710-96-4 |
| Standard InChI | InChI=1S/C21H22O5/c1-11(2)4-5-12-6-14-18(8-16(12)22)25-10-15-13-7-20(24-3)17(23)9-19(13)26-21(14)15/h4,6-9,15,21-23H,5,10H2,1-3H3/t15-,21-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O5/c1-11(2)4-5-12-6-14-18(8-16(12)22)25-10-15-13-7-20(24-3)17(23)9-19(13)26-21(14)15/h4,6-9,15,21-23H,5,10H2,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 188 |
| By standard InChI | CHEMBL1079408 |
|---|---|
| By standard InChI Main Layer | CHEMBL1079408 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Erythrina variegata | 3845 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL1079408 |
CHEMBL1101504
(1)
|
0 / 0 |