| id | C00020025 |
|---|---|
| Name | Seselinol isovalerate |
| CAS RN | 138614-70-7 |
| Standard InChI | InChI=1S/C19H20O5/c1-12(2)10-17(21)22-11-19(3)9-8-14-15(24-19)6-4-13-5-7-16(20)23-18(13)14/h4-9,12H,10-11H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H20O5/c1-12(2)10-17(21)22-11-19(3)9-8-14-15(24-19)6-4-13-5-7-16(20)23-18(13)14/h4-9,12H,10-11H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1945 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Citrus hassaku | 488171 | Rutaceae | rosids | Viridiplantae |