| id | C00020289 |
|---|---|
| Name | Cinnamolide |
| CAS RN | 23599-47-5 |
| Standard InChI | InChI=1S/C15H22O2/c1-14(2)7-4-8-15(3)11-9-17-13(16)10(11)5-6-12(14)15/h5,11-12H,4,6-9H2,1-3H3/t11-,12-,15+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H22O2/c1-14(2)7-4-8-15(3)11-9-17-13(16)10(11)5-6-12(14)15/h5,11-12H,4,6-9H2,1-3H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 950 |
| By standard InChI | CHEMBL218666 |
|---|---|
| By standard InChI Main Layer | CHEMBL218666 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 2 |
| family name | count |
|---|---|
| Canellaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cinnamosma fragrans | 132964 | Canellaceae | Magnoliophyta | Viridiplantae |
| Cinnamosma macrocarpa | 132964 | Canellaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O43451 | Maltase-glucoamylase, intestinal | Hydrolase | CHEMBL218666 |
CHEMBL856853
(1)
|
0 / 0 |