| id | C00000210 |
|---|---|
| Name | L-Pepecolic acid |
| CAS RN | |
| Standard InChI | InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)/t5-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9) |
| Phytochemical cluster | No. 1 |
|---|---|
| KCF-S cluster | No. 1523 |
| By standard InChI | CHEMBL322883 |
|---|---|
| By standard InChI Main Layer | CHEMBL308408 CHEMBL322883 CHEMBL1231898 |
| By LinkDB | C00408 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 2 |
| family name | count |
|---|---|
| Araceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lemna gibba | 4470 | Araceae | Liliopsida | Viridiplantae |
| Lemna paucicostata | 89585 | Araceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL308408 |
CHEMBL1014033
(1)
|
0 / 3 |
| Q9P0Z9 | Peroxisomal sarcosine oxidase | Enzyme | CHEMBL308408 CHEMBL322883 |
CHEMBL700838
(1)
CHEMBL700620
(1)
CHEMBL878698 (1) CHEMBL700621 (1) |
0 / 0 |
| Q7Z2H8 | Proton-coupled amino acid transporter 1 | Unclassified protein | CHEMBL322883 CHEMBL1231898 |
CHEMBL1919336
(4)
|
0 / 0 |