| id | C00021018 |
|---|---|
| Name | 3beta-Acetoxy-desoxo-achalensolide |
| CAS RN | 117824-97-2 |
| Standard InChI | InChI=1S/C17H22O4/c1-8-5-16-14(10(3)17(19)21-16)6-13-9(2)15(7-12(8)13)20-11(4)18/h8,12,14-16H,3,5-7H2,1-2,4H3/t8-,12-,14+,15-,16+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H22O4/c1-8-5-16-14(10(3)17(19)21-16)6-13-9(2)15(7-12(8)13)20-11(4)18/h8,12,14-16H,3,5-7H2,1-2,4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 157 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stevia polyphylla | 55669 | Asteraceae | asterids | Viridiplantae |