| id | C00002166 |
|---|---|
| Name | Glycoperine |
| CAS RN | 55740-45-9 |
| Standard InChI | InChI=1S/C19H21NO8/c1-8-13(21)14(22)15(23)19(27-8)28-11-5-4-9-12(17(11)25-3)20-18-10(6-7-26-18)16(9)24-2/h4-8,13-15,19,21-23H,1-3H3/t8?,13-,14-,15?,19-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C19H21NO8/c1-8-13(21)14(22)15(23)19(27-8)28-11-5-4-9-12(17(11)25-3)20-18-10(6-7-26-18)16(9)24-2/h4-8,13-15,19,21-23H,1-3H3 |
| Phytochemical cluster | No. 7 |
|---|---|
| KCF-S cluster | No. 6513 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1613094 |
| By LinkDB | C10686 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Haplophyllum perforatum | 266078 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1613094 |
CHEMBL1614458
(1)
|
0 / 0 |
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL1613094 |
CHEMBL1614038
(1)
|
2 / 2 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1613094 |
CHEMBL1613914
(1)
|
0 / 0 |