| id | C00002171 |
|---|---|
| Name | Haplophyllidine |
| CAS RN | 18063-21-3 |
| Standard InChI | InChI=1S/C18H23NO4/c1-11(2)7-9-18(22-4)14(20)6-5-12-15(21-3)13-8-10-23-17(13)19-16(12)18/h7-8,10,14,20H,5-6,9H2,1-4H3/t14-,18+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H23NO4/c1-11(2)7-9-18(22-4)14(20)6-5-12-15(21-3)13-8-10-23-17(13)19-16(12)18/h7-8,10,14,20H,5-6,9H2,1-4H3 |
| Phytochemical cluster | No. 7 |
|---|---|
| KCF-S cluster | No. 1718 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1864455 |
| By LinkDB | C10692 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Haplophyllum perforatum | 266078 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL1864455 |
CHEMBL2114843
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1864455 |
CHEMBL1794401
(1)
|
0 / 0 |