| id | C00021865 |
|---|---|
| Name | Copadiene |
| CAS RN | 27597-38-2 |
| Standard InChI | InChI=1S/C15H22/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h5-6,9,11-14H,3,7-8H2,1-2,4H3/t11-,12+,13+,14?,15?/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H22/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h5-6,9,11-14H,3,7-8H2,1-2,4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 333 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Cyperaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cyperus rotundus | 512623 | Cyperaceae | Liliopsida | Viridiplantae |