| id | C00002226 |
|---|---|
| Name | (-)-Lupinine |
| CAS RN | 486-70-4 |
| Standard InChI | InChI=1S/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2 |
| Phytochemical cluster | No. 3 |
|---|---|
| KCF-S cluster | No. 1838 |
| By standard InChI | CHEMBL459397 |
|---|---|
| By standard InChI Main Layer | CHEMBL459397 CHEMBL1435718 |
| By LinkDB | C10773 |
|---|
| By CAS RN | C015971 |
|---|
| class name | count |
|---|---|
| rosids | 4 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Fabaceae | 4 |
| Amaranthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Anabasis aphylla | 454461 | Amaranthaceae | eudicotyledons | Viridiplantae |
| Calpurnia aurea subsp. aurea | 53847 | Fabaceae | rosids | Viridiplantae |
| Lamprolobium fruticosum | 705551 | Fabaceae | rosids | Viridiplantae |
| Lupinus luteus | 3873 | Fabaceae | rosids | Viridiplantae |
| Lupinus palmeri | 3869 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL1435718 |
CHEMBL1614364
(1)
|
1 / 1 |