| id | C00023719 |
|---|---|
| Name | p-Toluquinone |
| CAS RN | 553-97-9 |
| Standard InChI | InChI=1S/C7H6O2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C7H6O2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6326 |
| By standard InChI | CHEMBL358225 |
|---|---|
| By standard InChI Main Layer | CHEMBL358225 |
| By LinkDB |
|---|
| By CAS RN | C042889 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aspergillaceae | 3 |
| Hypocreaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Nectria erubescens | 5129 | Hypocreaceae | Fungi | |
| Penicillium griseofulvum | 5078 | Aspergillaceae | Fungi | |
| Penicillium lanosum | 357984 | Aspergillaceae | Fungi | |
| Penicillium urticae | 29844 | Aspergillaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14902 | Indoleamine 2,3-dioxygenase 1 | Enzyme | CHEMBL358225 |
CHEMBL935410
(1)
|
0 / 0 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C042889 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | 2-methyl-1,4-benzoquinone results in decreased activity of CASP3 protein |
decreases activity
|
protein |
17051661
|