id | C00023719 |
---|---|
Name | p-Toluquinone |
CAS RN | 553-97-9 |
Standard InChI | InChI=1S/C7H6O2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
Standard InChI (Main Layer) | InChI=1S/C7H6O2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 6326 |
By standard InChI | CHEMBL358225 |
---|---|
By standard InChI Main Layer | CHEMBL358225 |
By LinkDB |
---|
By CAS RN | C042889 |
---|
class name | count |
---|
family name | count |
---|---|
Aspergillaceae | 3 |
Hypocreaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Nectria erubescens | 5129 | Hypocreaceae | Fungi | |
Penicillium griseofulvum | 5078 | Aspergillaceae | Fungi | |
Penicillium lanosum | 357984 | Aspergillaceae | Fungi | |
Penicillium urticae | 29844 | Aspergillaceae | Fungi |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P14902 | Indoleamine 2,3-dioxygenase 1 | Enzyme | CHEMBL358225 |
CHEMBL935410
(1)
|
0 / 0 |
compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
---|---|---|---|---|---|---|---|
C042889 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | 2-methyl-1,4-benzoquinone results in decreased activity of CASP3 protein |
decreases activity
|
protein |
17051661
|