| id | C00023981 |
|---|---|
| Name | Emericellin / Variecoxanthone B |
| CAS RN | 55812-93-5 |
| Standard InChI | InChI=1S/C25H28O5/c1-14(2)6-7-17-8-9-19(27)22-23(28)21-18(13-26)24(29-11-10-15(3)4)16(5)12-20(21)30-25(17)22/h6,8-10,12,26-27H,7,11,13H2,1-5H3 |
| Standard InChI (Main Layer) | InChI=1S/C25H28O5/c1-14(2)6-7-17-8-9-19(27)22-23(28)21-18(13-26)24(29-11-10-15(3)4)16(5)12-20(21)30-25(17)22/h6,8-10,12,26-27H,7,11,13H2,1-5H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | CHEMBL525537 |
|---|---|
| By standard InChI Main Layer | CHEMBL525537 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aspergillaceae | 4 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aspergillus nidulans | 162425 | Aspergillaceae | Fungi | |
| Aspergillus quadrilineatus | 41735 | Aspergillaceae | Fungi | |
| Aspergillus rugulosus | 41736 | Aspergillaceae | Fungi | |
| Aspergillus variecolor strain CBS 135-55 | 5052 | Aspergillaceae | Fungi | |
| Emericella nidulans var.acristata |