| id | C00002417 |
|---|---|
| Name | Biflorin |
| CAS RN | 89701-85-9 |
| Standard InChI | InChI=1S/C16H18O9/c1-5-2-6(18)10-8(24-5)3-7(19)11(13(10)21)16-15(23)14(22)12(20)9(4-17)25-16/h2-3,9,12,14-17,19-23H,4H2,1H3/t9?,12-,14+,15?,16+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H18O9/c1-5-2-6(18)10-8(24-5)3-7(19)11(13(10)21)16-15(23)14(22)12(20)9(4-17)25-16/h2-3,9,12,14-17,19-23H,4H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1013 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL463312 |
| By LinkDB | C08996 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| Liliopsida | 1 |
| Euphyllophyta | 1 |
| family name | count |
|---|---|
| Scrophulariaceae | 1 |
| Amaryllidaceae | 1 |
| Dryopteridaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dryopteris crassirhizoma | 97234 | Dryopteridaceae | Euphyllophyta | Viridiplantae |
| Eremophila neglecta | 4149 | Scrophulariaceae | asterids | Viridiplantae |
| Pancratium biflorum | 82238 | Amaryllidaceae | Liliopsida | Viridiplantae |