| id | C00024199 |
|---|---|
| Name | Gerontoxanthone H |
| CAS RN | 125140-06-9 |
| Standard InChI | InChI=1S/C23H24O5/c1-12(2)5-7-14-16(24)9-10-19-20(14)22(27)21-18(26)11-17(25)15(23(21)28-19)8-6-13(3)4/h5-6,9-11,24-26H,7-8H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C23H24O5/c1-12(2)5-7-14-16(24)9-10-19-20(14)22(27)21-18(26)11-17(25)15(23(21)28-19)8-6-13(3)4/h5-6,9-11,24-26H,7-8H2,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | CHEMBL514057 |
|---|---|
| By standard InChI Main Layer | CHEMBL514057 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cudrania cochinchinensis (LOUR.) KUDO & MASAMUNE var.gerontogea (S.& Z.) KUDO & MASAMUNE | 3495 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL514057 |
CHEMBL2114784
(1)
|
1 / 1 |
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL514057 |
CHEMBL2354282
(1)
|
4 / 2 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL514057 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL514057 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL514057 |
CHEMBL2114788
(1)
|
0 / 0 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL514057 |
CHEMBL1737991
(1)
|
0 / 0 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL514057 |
CHEMBL1738184
(1)
|
0 / 0 |
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL514057 |
CHEMBL1964082
(1)
CHEMBL1964002
(1)
CHEMBL2354311 (1) |
1 / 0 |
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL514057 |
CHEMBL2354287
(1)
|
1 / 1 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #612069 | Amyotrophic lateral sclerosis 10, with or without frontotemporal dementia; als10 |
Q13148
|
| #114500 | Colorectal cancer; crc |
P84022
|
| #127750 | Dementia, lewy body; dlb |
P37840
|
| #137800 | Glioma susceptibility 1; glm1 |
O75874
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|
| #168601 | Parkinson disease 1, autosomal dominant; park1 |
P37840
|
| #605543 | Parkinson disease 4, autosomal dominant; park4 |
P37840
|
| #168600 | Parkinson disease, late-onset; pd |
P37840
|
| #183090 | Spinocerebellar ataxia 2; sca2 |
Q99700
|