| id | C00024321 | 
|---|---|
| Name | Vincamajinine | 
| CAS RN | 1748-05-6 | 
| Standard InChI | InChI=1S/C22H26N2O3/c1-4-12-11-24-16-9-14(12)22(20(26)27-3)17(24)10-21(19(22)25)13-7-5-6-8-15(13)23(2)18(16)21/h4-8,14,16-19,25H,9-11H2,1-3H3/b12-4-/t14-,16-,17-,18+,19+,21+,22?/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C22H26N2O3/c1-4-12-11-24-16-9-14(12)22(20(26)27-3)17(24)10-21(19(22)25)13-7-5-6-8-15(13)23(2)18(16)21/h4-8,14,16-19,25H,9-11H2,1-3H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 507 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL607365 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Apocynaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Vinca major | 185238 | Apocynaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL607365 | CHEMBL1070175
                        (1) | 1 / 1 | 
| P31639 | Sodium/glucose cotransporter 2 | Glucose | CHEMBL607365 | CHEMBL1070176
                        (1) | 1 / 1 |