| id | C00002447 | 
|---|---|
| Name | Visnagin | 
| CAS RN | 82-57-5 | 
| Standard InChI | InChI=1S/C13H10O4/c1-7-5-9(14)12-11(17-7)6-10-8(3-4-16-10)13(12)15-2/h3-6H,1-2H3 | 
| Standard InChI (Main Layer) | InChI=1S/C13H10O4/c1-7-5-9(14)12-11(17-7)6-10-8(3-4-16-10)13(12)15-2/h3-6H,1-2H3 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 4127 | 
| By standard InChI | CHEMBL45176 | 
|---|---|
| By standard InChI Main Layer | CHEMBL45176 | 
| By LinkDB | C09049 | 
|---|
| By CAS RN | C044999 | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Ammi visnaga | 1053409 | Apiaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL45176 | CHEMBL638578
                        (1)
                        CHEMBL641515
                        (1) | 0 / 0 | 
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL45176 | CHEMBL1613776
                        (1) | 3 / 1 | 
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL45176 | CHEMBL1613808
                        (1) | 0 / 0 | 
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL45176 | CHEMBL1614038
                        (1) | 2 / 2 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL45176 | CHEMBL1614108
                        (1)
                        CHEMBL1613886
                        (1) | 0 / 1 | 
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL45176 | CHEMBL2354287
                        (1) | 1 / 1 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #612069 | Amyotrophic lateral sclerosis 10, with or without frontotemporal dementia; als10 | Q13148 | 
| #119900 | Digital clubbing, isolated congenital | P15428 | 
| #259100 | Hypertrophic osteoarthropathy, primary, autosomal recessive, 1; phoar1 | P15428 | 
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth | P10828 | 
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth | P10828 | 
| #145650 | Thyroid hormone resistance, selective pituitary; prth | P10828 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H00249 | Thyroid hormone resistance syndrome | P10828
                            (related) | 
| H00457 | Primary hypertrophic osteoarthropathy (PHO) | P15428
                            (related) | 
| H01246 | Isolated congenital nail clubbing (ICNC) | P15428
                            (related) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | Q13148
                            (related) |