| id | C00024634 |
|---|---|
| Name | Chelerythrine |
| CAS RN | 34316-15-9 |
| Standard InChI | InChI=1S/C21H18NO4/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22/h4-10H,11H2,1-3H3/q+1 |
| Standard InChI (Main Layer) | InChI=1S/C21H18NO4/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22/h4-10H,11H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 254 |
| By standard InChI | CHEMBL13045 |
|---|---|
| By standard InChI Main Layer | CHEMBL13045 |
| By LinkDB | C12227 |
|---|
| By CAS RN | C016299 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| rosids | 1 |
| family name | count |
|---|---|
| Papaveraceae | 2 |
| Rutaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dicentra peregrina Rudolph | 22680 | Papaveraceae | eudicotyledons | Viridiplantae |
| Glaucium squamigerum Kar.et Kir. | 56852 | Papaveraceae | eudicotyledons | Viridiplantae |
| Zanthoxylum spinosum Swingle | 67937 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL13045 |
CHEMBL1614110
(1)
CHEMBL1741321
(1)
|
1 / 0 |
| P42345 | Serine/threonine-protein kinase mTOR | Enzyme | CHEMBL13045 |
CHEMBL1614009
(1)
CHEMBL2219345
(1)
CHEMBL2219346 (1) CHEMBL2219347 (1) CHEMBL2219348 (1) |
0 / 0 |
| Q02750 | Dual specificity mitogen-activated protein kinase kinase 1 | Ste7 | CHEMBL13045 |
CHEMBL2219261
(1)
CHEMBL2219262
(1)
|
1 / 1 |
| P36897 | TGF-beta receptor type-1 | TKL dual-specificity kinase STKR type 1 subfamily | CHEMBL13045 |
CHEMBL2219207
(1)
CHEMBL2219208
(1)
|
3 / 2 |
| P04637 | Cellular tumor antigen p53 | Transcription Factor | CHEMBL13045 |
CHEMBL1613992
(1)
CHEMBL1613995
(1)
|
7 / 44 |
| Q13555 | Calcium/calmodulin-dependent protein kinase type II subunit gamma | Camk2 | CHEMBL13045 |
CHEMBL2219012
(1)
CHEMBL2219013
(1)
|
0 / 0 |
| P29322 | Ephrin type-A receptor 8 | Eph | CHEMBL13045 |
CHEMBL2219048
(1)
CHEMBL2219049
(1)
|
0 / 0 |
| P42685 | Tyrosine-protein kinase FRK | Src | CHEMBL13045 |
CHEMBL2219131
(1)
CHEMBL2219132
(1)
|
0 / 0 |
| Q13043 | Serine/threonine-protein kinase 4 | STE serine/threonine protein kinase MST subfamily | CHEMBL13045 |
CHEMBL2219285
(1)
CHEMBL2219286
(1)
|
1 / 0 |
| Q9P1W9 | Serine/threonine-protein kinase pim-2 | Pim | CHEMBL13045 |
CHEMBL2219137
(1)
CHEMBL2219138
(1)
|
0 / 0 |
| Q8TDX7 | Serine/threonine-protein kinase Nek7 | Nek | CHEMBL13045 |
CHEMBL2219353
(1)
CHEMBL2219354
(1)
|
0 / 0 |
| Q5VT25 | Serine/threonine-protein kinase MRCK alpha | AGC serine/threonine protein kinase GEK subfamily | CHEMBL13045 |
CHEMBL2219275
(1)
CHEMBL2219276
(1)
|
0 / 0 |
| Q14289 | Protein-tyrosine kinase 2-beta | Fak | CHEMBL13045 |
CHEMBL2219147
(1)
CHEMBL2219148
(1)
|
0 / 0 |
| P08922 | Proto-oncogene tyrosine-protein kinase ROS | TK tyrosine-protein kinase SEV | CHEMBL13045 |
CHEMBL2219159
(1)
CHEMBL2219160
(1)
|
0 / 1 |
| Q15831 | Serine/threonine-protein kinase STK11 | Lkb | CHEMBL13045 |
CHEMBL2219241
(1)
CHEMBL2219242
(1)
|
2 / 2 |
| Q16637 | Survival motor neuron protein | Unclassified protein | CHEMBL13045 |
CHEMBL1613842
(1)
|
4 / 2 |
| Q9Y6L6 | Solute carrier organic anion transporter family member 1B1 | Electrochemical transporter | CHEMBL13045 |
CHEMBL2169429
(1)
|
1 / 0 |
| O94956 | Solute carrier organic anion transporter family member 2B1 | Unclassified protein | CHEMBL13045 |
CHEMBL2169431
(1)
|
0 / 0 |
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL13045 |
CHEMBL1794367
(1)
CHEMBL2114784
(1)
|
1 / 1 |
| P49798 | Regulator of G-protein signaling 4 | Unclassified protein | CHEMBL13045 |
CHEMBL1794499
(1)
|
2 / 0 |
| Q9BYP7 | Serine/threonine-protein kinase WNK3 | WNK serine/threonine protein kinase subfamily | CHEMBL13045 |
CHEMBL2219329
(1)
CHEMBL2219330
(1)
|
0 / 0 |
| P08069 | Insulin-like growth factor 1 receptor | TK tyrosine-protein kinase INSR subfamily | CHEMBL13045 |
CHEMBL2219110
(1)
CHEMBL2219111
(1)
CHEMBL2219209 (1) CHEMBL2219210 (1) |
1 / 3 |
| Q15759 | Mitogen-activated protein kinase 11 | p38 | CHEMBL13045 |
CHEMBL2219173
(1)
CHEMBL2219174
(1)
|
0 / 0 |
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL13045 |
CHEMBL2219171
(1)
CHEMBL2219172
(1)
|
0 / 0 |
| P21802 | Fibroblast growth factor receptor 2 | TK tyrosine-protein kinase TLK subfamily | CHEMBL13045 |
CHEMBL2219064
(1)
CHEMBL2219065
(1)
|
9 / 3 |
| O15530 | 3-phosphoinositide-dependent protein kinase 1 | Pdk1 | CHEMBL13045 |
CHEMBL2219388
(1)
CHEMBL2219389
(1)
|
0 / 0 |
| Q9UIK4 | Death-associated protein kinase 2 | Dapk | CHEMBL13045 |
CHEMBL2219022
(1)
CHEMBL2219023
(1)
|
0 / 0 |
| P41240 | Tyrosine-protein kinase CSK | Csk | CHEMBL13045 |
CHEMBL2219006
(1)
CHEMBL2219007
(1)
|
0 / 0 |
| P45984 | Mitogen-activated protein kinase 9 | Jnk | CHEMBL13045 |
CHEMBL2219233
(1)
CHEMBL2219234
(1)
|
0 / 0 |
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL13045 |
CHEMBL2219398
(1)
CHEMBL2219399
(1)
|
0 / 0 |
| P27361 | Mitogen-activated protein kinase 3 | Erk | CHEMBL13045 |
CHEMBL2219251
(1)
CHEMBL2219252
(1)
|
0 / 0 |
| Q15349 | Ribosomal protein S6 kinase alpha-2 | Rskb | CHEMBL13045 |
CHEMBL2219167
(1)
CHEMBL2219168
(1)
|
0 / 0 |
| P04629 | High affinity nerve growth factor receptor | Trk | CHEMBL13045 |
CHEMBL2219315
(1)
CHEMBL2219316
(1)
|
2 / 4 |
| Q05655 | Protein kinase C delta type | Delta | CHEMBL13045 |
CHEMBL2219406
(1)
CHEMBL2219407
(1)
|
0 / 0 |
| Q04759 | Protein kinase C theta type | Delta | CHEMBL13045 |
CHEMBL2219115
(1)
CHEMBL2219116
(1)
|
0 / 1 |
| Q15303 | Receptor tyrosine-protein kinase erbB-4 | TK tyrosine-protein kinase EGFR subfamily | CHEMBL13045 |
CHEMBL2219058
(1)
CHEMBL2219059
(1)
|
0 / 0 |
| O14757 | Serine/threonine-protein kinase Chk1 | Chk1 | CHEMBL13045 |
CHEMBL2218986
(1)
CHEMBL2218987
(1)
|
0 / 0 |
| O14965 | Aurora kinase A | Aur | CHEMBL13045 |
CHEMBL2218948
(1)
CHEMBL2218949
(1)
|
0 / 0 |
| Q7KZI7 | Serine/threonine-protein kinase MARK2 | CAMK serine/threonine protein kinase MARK subfamily | CHEMBL13045 |
CHEMBL2219367
(1)
CHEMBL2219368
(1)
|
0 / 0 |
| Q13882 | Protein-tyrosine kinase 6 | Src | CHEMBL13045 |
CHEMBL2218956
(1)
CHEMBL2218957
(1)
|
0 / 0 |
| Q8IWQ3 | Serine/threonine-protein kinase BRSK2 | CAMK serine/threonine protein kinase BRSK subfamily | CHEMBL13045 |
CHEMBL2218966
(1)
CHEMBL2218967
(1)
|
0 / 0 |
| Q9UHD2 | Serine/threonine-protein kinase TBK1 | Ikk | CHEMBL13045 |
CHEMBL2219205
(1)
CHEMBL2219206
(1)
|
1 / 0 |
| P21709 | Ephrin type-A receptor 1 | Eph | CHEMBL13045 |
CHEMBL2219036
(1)
CHEMBL2219037
(1)
|
0 / 0 |
| Q9P0L2 | Serine/threonine-protein kinase MARK1 | CAMK serine/threonine protein kinase MARK subfamily | CHEMBL13045 |
CHEMBL2219259
(1)
CHEMBL2219260
(1)
|
0 / 0 |
| O75604 | Ubiquitin carboxyl-terminal hydrolase 2 | Enzyme | CHEMBL13045 |
CHEMBL1614331
(1)
|
0 / 0 |
| Q96PF2 | Testis-specific serine/threonine-protein kinase 2 | CAMK serine/threonine protein kinase TSSK subfamily | CHEMBL13045 |
CHEMBL2219309
(1)
CHEMBL2219310
(1)
|
0 / 0 |
| P51956 | Serine/threonine-protein kinase Nek3 | Nek1 | CHEMBL13045 |
CHEMBL2219303
(1)
CHEMBL2219304
(1)
|
0 / 0 |
| P00519 | Tyrosine-protein kinase ABL1 | Abl | CHEMBL13045 |
CHEMBL2218944
(1)
CHEMBL2218945
(1)
|
1 / 4 |
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL13045 |
CHEMBL1614281
(1)
CHEMBL1614361
(1)
|
3 / 2 |
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL13045 |
CHEMBL1614554
(1)
|
3 / 1 |
| Q05513 | Protein kinase C zeta type | Iota | CHEMBL13045 |
CHEMBL2219112
(1)
CHEMBL2218942
(1)
|
0 / 0 |
| P11309 | Serine/threonine-protein kinase pim-1 | Pim | CHEMBL13045 |
CHEMBL2219135
(1)
CHEMBL2219136
(1)
|
0 / 0 |
| Q02156 | Protein kinase C epsilon type | Eta | CHEMBL13045 |
CHEMBL2219408
(1)
CHEMBL2219409
(1)
|
0 / 0 |
| P41743 | Protein kinase C iota type | Iota | CHEMBL13045 |
CHEMBL2219117
(1)
CHEMBL2219118
(1)
|
0 / 0 |
| Q9UK32 | Ribosomal protein S6 kinase alpha-6 | Rskb | CHEMBL13045 |
CHEMBL2219169
(1)
CHEMBL2219170
(1)
|
0 / 0 |
| Q04912 | Macrophage-stimulating protein receptor | TK tyrosine-protein kinase MET subfamily | CHEMBL13045 |
CHEMBL2219157
(1)
CHEMBL2219158
(1)
|
0 / 0 |
| Q13557 | Calcium/calmodulin-dependent protein kinase type II subunit delta | Camk2 | CHEMBL13045 |
CHEMBL2219014
(1)
CHEMBL2219015
(1)
|
0 / 0 |
| P06241 | Tyrosine-protein kinase Fyn | Src | CHEMBL13045 |
CHEMBL2219084
(1)
CHEMBL2219085
(1)
|
0 / 0 |
| P80192 | Mitogen-activated protein kinase kinase kinase 9 | TKL dual-specificity kinase MLK | CHEMBL13045 |
CHEMBL2219273
(1)
CHEMBL2219274
(1)
|
0 / 0 |
| P43403 | Tyrosine-protein kinase ZAP-70 | Syk | CHEMBL13045 |
CHEMBL2219333
(1)
CHEMBL2219334
(1)
|
1 / 2 |
| P16234 | Platelet-derived growth factor receptor alpha | Pdgfr | CHEMBL13045 |
CHEMBL2219384
(1)
CHEMBL2219385
(1)
|
2 / 1 |
| P19784 | Casein kinase II subunit alpha' | Ck2 | CHEMBL13045 |
CHEMBL2218998
(1)
CHEMBL2218999
(1)
CHEMBL2219000 (1) CHEMBL2219001 (1) |
0 / 0 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL13045 |
CHEMBL1614027
(1)
CHEMBL1741325
(1)
|
0 / 1 |
| P23443 | Ribosomal protein S6 kinase beta-1 | p70 | CHEMBL13045 |
CHEMBL2219349
(1)
CHEMBL2219350
(1)
|
0 / 0 |
| Q9UQB9 | Aurora kinase C | Aur | CHEMBL13045 |
CHEMBL2218952
(1)
CHEMBL2218953
(1)
|
1 / 1 |
| P49761 | Dual specificity protein kinase CLK3 | Clk | CHEMBL13045 |
CHEMBL2219004
(1)
CHEMBL2219005
(1)
|
0 / 0 |
| P51813 | Cytoplasmic tyrosine-protein kinase BMX | Tec | CHEMBL13045 |
CHEMBL2218962
(1)
CHEMBL2218963
(1)
|
0 / 0 |
| Q9HBH9 | MAP kinase-interacting serine/threonine-protein kinase 2 | CAMK serine/threonine protein kinase MNK subfamily | CHEMBL13045 |
CHEMBL2219295
(1)
CHEMBL2219296
(1)
|
0 / 0 |
| Q9NQU5 | Serine/threonine-protein kinase PAK 6 | STE serine/threonine protein kinase PAKB subfamily | CHEMBL13045 |
CHEMBL2219365
(1)
CHEMBL2219366
(1)
|
0 / 0 |
| Q16644 | MAP kinase-activated protein kinase 3 | CAMK serine/threonine protein kinase MAPKAPK | CHEMBL13045 |
CHEMBL2219257
(1)
CHEMBL2219258
(1)
|
0 / 0 |
| Q06187 | Tyrosine-protein kinase BTK | Tec | CHEMBL13045 |
CHEMBL2218958
(1)
CHEMBL2218959
(1)
|
2 / 2 |
| Q9H422 | Homeodomain-interacting protein kinase 3 | CMGC dual-specificity kinase HIPK | CHEMBL13045 |
CHEMBL2219102
(1)
CHEMBL2219103
(1)
|
0 / 0 |
| Q14680 | Maternal embryonic leucine zipper kinase | Melk | CHEMBL13045 |
CHEMBL2219263
(1)
CHEMBL2219264
(1)
|
0 / 0 |
| Q9UBE8 | Serine/threonine-protein kinase NLK | CMGC serine/threonine protein kinase NMO subfamily | CHEMBL13045 |
CHEMBL2219355
(1)
CHEMBL2219356
(1)
|
0 / 0 |
| Q12866 | Tyrosine-protein kinase Mer | TK tyrosine-protein kinase AXL | CHEMBL13045 |
CHEMBL2219291
(1)
CHEMBL2219292
(1)
|
1 / 1 |
| Q00535 | Cyclin-dependent kinase 5 | Cdk5 | CHEMBL13045 |
CHEMBL2218976
(1)
CHEMBL2218977
(1)
CHEMBL2218978 (1) CHEMBL2218979 (1) |
0 / 0 |
| Q15078 | Cyclin-dependent kinase 5 activator 1 | REG serine/threonine protein kinase family | CHEMBL13045 |
CHEMBL2218976
(1)
CHEMBL2218977
(1)
CHEMBL2218978 (1) CHEMBL2218979 (1) |
0 / 0 |
| Q9Y5S2 | Serine/threonine-protein kinase MRCK beta | AGC serine/threonine protein kinase GEK subfamily | CHEMBL13045 |
CHEMBL2219277
(1)
CHEMBL2219278
(1)
|
0 / 0 |
| Q8N4C8 | Misshapen-like kinase 1 | STE serine/threonine protein kinase MSN subfamily | CHEMBL13045 |
CHEMBL2219265
(1)
CHEMBL2219266
(1)
|
0 / 0 |
| Q9NYY3 | Serine/threonine-protein kinase PLK2 | Plk2 | CHEMBL13045 |
CHEMBL2219193
(1)
CHEMBL2219194
(1)
|
0 / 0 |
| P43250 | G protein-coupled receptor kinase 6 | AGC serine/threonine protein kinase GRK subfamily | CHEMBL13045 |
CHEMBL2219090
(1)
CHEMBL2219091
(1)
|
0 / 0 |
| Q96BR1 | Serine/threonine-protein kinase Sgk3 | AGC serine/threonine protein kinase SGK subfamily | CHEMBL13045 |
CHEMBL2219183
(1)
CHEMBL2219184
(1)
|
0 / 0 |
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL13045 |
CHEMBL2219034
(1)
CHEMBL2219035
(1)
|
1 / 11 |
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL13045 |
CHEMBL1794311
(1)
|
2 / 3 |
| O43293 | Death-associated protein kinase 3 | Dapk | CHEMBL13045 |
CHEMBL2219335
(1)
CHEMBL2219336
(1)
|
0 / 0 |
| Q15746 | Myosin light chain kinase, smooth muscle | Mlck | CHEMBL13045 |
CHEMBL2219271
(1)
CHEMBL2219272
(1)
|
1 / 1 |
| Q13188 | Serine/threonine-protein kinase 3 | STE serine/threonine protein kinase MST subfamily | CHEMBL13045 |
CHEMBL2219287
(1)
CHEMBL2219288
(1)
|
0 / 0 |
| P31751 | RAC-beta serine/threonine-protein kinase | Akt | CHEMBL13045 |
CHEMBL2219394
(1)
CHEMBL2219395
(1)
|
2 / 2 |
| Q9Y243 | RAC-gamma serine/threonine-protein kinase | Akt | CHEMBL13045 |
CHEMBL2219396
(1)
CHEMBL2219397
(1)
|
1 / 0 |
| O75582 | Ribosomal protein S6 kinase alpha-5 | CAMK serine/threonine protein kinase MSKB subfamily | CHEMBL13045 |
CHEMBL2219279
(1)
CHEMBL2219280
(1)
|
0 / 0 |
| O14920 | Inhibitor of nuclear factor kappa-B kinase subunit beta | Other serine/threonine protein kinase | CHEMBL13045 |
CHEMBL2219213
(1)
CHEMBL2219214
(1)
|
0 / 0 |
| Q13464 | Rho-associated protein kinase 1 | Rock | CHEMBL13045 |
CHEMBL2219151
(1)
CHEMBL2219152
(1)
|
0 / 0 |
| Q16513 | Serine/threonine-protein kinase N2 | Pkn | CHEMBL13045 |
CHEMBL2219129
(1)
CHEMBL2219130
(1)
|
0 / 0 |
| Q15139 | Serine/threonine-protein kinase D1 | Pkd | CHEMBL13045 |
CHEMBL2219119
(1)
CHEMBL2219120
(1)
|
0 / 0 |
| O15296 | Arachidonate 15-lipoxygenase B | Enzyme | CHEMBL13045 |
CHEMBL1613800
(2)
|
0 / 0 |
| P17948 | Vascular endothelial growth factor receptor 1 | Vegfr | CHEMBL13045 |
CHEMBL2219076
(1)
CHEMBL2219077
(1)
|
0 / 0 |
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL13045 |
CHEMBL1614458
(2)
|
0 / 0 |
| P78368 | Casein kinase I isoform gamma-2 | Ck1 | CHEMBL13045 |
CHEMBL2218992
(1)
CHEMBL2218993
(1)
|
0 / 0 |
| P36888 | Receptor-type tyrosine-protein kinase FLT3 | Pdgfr | CHEMBL13045 |
CHEMBL2219078
(1)
CHEMBL2219079
(1)
|
1 / 1 |
| P07947 | Tyrosine-protein kinase Yes | Src | CHEMBL13045 |
CHEMBL2219331
(1)
CHEMBL2219332
(1)
|
0 / 0 |
| P51617 | Interleukin-1 receptor-associated kinase 1 | Irak | CHEMBL13045 |
CHEMBL2219219
(1)
CHEMBL2219220
(1)
|
0 / 0 |
| Q9NWZ3 | Interleukin-1 receptor-associated kinase 4 | Irak | CHEMBL13045 |
CHEMBL2219221
(1)
CHEMBL2219222
(1)
|
2 / 1 |
| O43353 | Receptor-interacting serine/threonine-protein kinase 2 | Ripk | CHEMBL13045 |
CHEMBL2219149
(1)
CHEMBL2219150
(1)
|
0 / 0 |
| P29320 | Ephrin type-A receptor 3 | Eph | CHEMBL13045 |
CHEMBL2219040
(1)
CHEMBL2219041
(1)
|
1 / 0 |
| P54764 | Ephrin type-A receptor 4 | Eph | CHEMBL13045 |
CHEMBL2219042
(1)
CHEMBL2219043
(1)
|
0 / 0 |
| Q9P286 | Serine/threonine-protein kinase PAK 7 | STE serine/threonine protein kinase PAKB subfamily | CHEMBL13045 |
CHEMBL2219363
(1)
CHEMBL2219364
(1)
|
0 / 0 |
| Q16665 | Hypoxia-inducible factor 1-alpha | Transcription Factor | CHEMBL13045 |
CHEMBL1614456
(1)
CHEMBL1613803
(1)
|
0 / 0 |
| Q16620 | BDNF/NT-3 growth factors receptor | Trk | CHEMBL13045 |
CHEMBL2219317
(1)
CHEMBL2219318
(1)
|
1 / 1 |
| P42680 | Tyrosine-protein kinase Tec | Tec | CHEMBL13045 |
CHEMBL2219311
(1)
CHEMBL2219312
(1)
|
0 / 0 |
| P42681 | Tyrosine-protein kinase TXK | Tec | CHEMBL13045 |
CHEMBL2219319
(1)
CHEMBL2219320
(1)
|
0 / 0 |
| Q96SB4 | SRSF protein kinase 1 | Srpk | CHEMBL13045 |
CHEMBL2219187
(1)
CHEMBL2219188
(1)
|
0 / 0 |
| Q92630 | Dual specificity tyrosine-phosphorylation-regulated kinase 2 | CMGC dual-specificity kinase DYRK2 | CHEMBL13045 |
CHEMBL2219032
(1)
CHEMBL2219033
(1)
|
0 / 0 |
| P07332 | Tyrosine-protein kinase Fes/Fps | Fer | CHEMBL13045 |
CHEMBL2219072
(1)
CHEMBL2219073
(1)
|
0 / 0 |
| O96013 | Serine/threonine-protein kinase PAK 4 | STE serine/threonine protein kinase PAKB subfamily | CHEMBL13045 |
CHEMBL2219361
(1)
CHEMBL2219362
(1)
|
0 / 0 |
| P09769 | Tyrosine-protein kinase Fgr | Src | CHEMBL13045 |
CHEMBL2219074
(1)
CHEMBL2219075
(1)
|
0 / 0 |
| P54760 | Ephrin type-B receptor 4 | Eph | CHEMBL13045 |
CHEMBL2219056
(1)
CHEMBL2219057
(1)
|
0 / 0 |
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL13045 |
CHEMBL1613922
(1)
CHEMBL1794486
(1)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL13045 |
CHEMBL1738606
(1)
|
0 / 0 |
| Q09013 | Myotonin-protein kinase | AGC serine/threonine protein kinase GEK subfamily | CHEMBL13045 |
CHEMBL2219028
(1)
CHEMBL2219029
(1)
|
1 / 1 |
| Q16832 | Discoidin domain-containing receptor 2 | Ddr | CHEMBL13045 |
CHEMBL2219026
(1)
CHEMBL2219027
(1)
|
1 / 1 |
| Q8IYT8 | Serine/threonine-protein kinase ULK2 | ULK serine/threonine protein kinase | CHEMBL13045 |
CHEMBL2219321
(1)
CHEMBL2219322
(1)
|
0 / 0 |
| Q9BYT3 | Serine/threonine-protein kinase 33 | Unique CAMK serine/threonine protein kinase | CHEMBL13045 |
CHEMBL2219191
(1)
CHEMBL2219192
(1)
|
0 / 0 |
| P57059 | Serine/threonine-protein kinase SIK1 | CAMK serine/threonine protein kinase QIK subfamily | CHEMBL13045 |
CHEMBL2219185
(1)
CHEMBL2219186
(1)
|
0 / 0 |
| P78362 | SRSF protein kinase 2 | Srpk | CHEMBL13045 |
CHEMBL2219189
(1)
CHEMBL2219190
(1)
|
0 / 0 |
| Q9HBY8 | Serine/threonine-protein kinase Sgk2 | AGC serine/threonine protein kinase SGK subfamily | CHEMBL13045 |
CHEMBL2219181
(1)
CHEMBL2219182
(1)
|
0 / 0 |
| P51151 | Ras-related protein Rab-9A | Unclassified protein | CHEMBL13045 |
CHEMBL1613838
(1)
|
0 / 0 |
| Q86Y07 | Serine/threonine-protein kinase VRK2 | Enzyme | CHEMBL13045 |
CHEMBL2219325
(1)
CHEMBL2219326
(1)
|
0 / 0 |
| Q9Y3S1 | Serine/threonine-protein kinase WNK2 | WNK serine/threonine protein kinase subfamily | CHEMBL13045 |
CHEMBL2219327
(1)
CHEMBL2219328
(1)
|
0 / 0 |
| P49841 | Glycogen synthase kinase-3 beta | Gsk | CHEMBL13045 |
CHEMBL2219096
(1)
CHEMBL2219097
(1)
|
0 / 0 |
| Q15418 | Ribosomal protein S6 kinase alpha-1 | Rskb | CHEMBL13045 |
CHEMBL2219163
(1)
CHEMBL2219164
(1)
|
0 / 0 |
| O15264 | Mitogen-activated protein kinase 13 | p38 | CHEMBL13045 |
CHEMBL2219177
(1)
CHEMBL2219178
(1)
|
0 / 0 |
| P42684 | Abelson tyrosine-protein kinase 2 | Abl | CHEMBL13045 |
CHEMBL2218946
(1)
CHEMBL2218947
(1)
|
0 / 0 |
| Q05397 | Focal adhesion kinase 1 | Fak | CHEMBL13045 |
CHEMBL2219060
(1)
CHEMBL2219061
(1)
|
0 / 0 |
| P53779 | Mitogen-activated protein kinase 10 | Jnk | CHEMBL13045 |
CHEMBL2219235
(1)
CHEMBL2219236
(1)
|
0 / 1 |
| P29323 | Ephrin type-B receptor 2 | Eph | CHEMBL13045 |
CHEMBL2219052
(1)
CHEMBL2219053
(1)
|
2 / 0 |
| O75914 | Serine/threonine-protein kinase PAK 3 | STE serine/threonine protein kinase PAKA subfamily | CHEMBL13045 |
CHEMBL2219359
(1)
CHEMBL2219360
(1)
|
1 / 1 |
| P15735 | Phosphorylase b kinase gamma catalytic chain, liver/testis isoform | Phk | CHEMBL13045 |
CHEMBL2219133
(1)
CHEMBL2219134
(1)
|
1 / 1 |
| Q02763 | Angiopoietin-1 receptor | Tie | CHEMBL13045 |
CHEMBL2219313
(1)
CHEMBL2219314
(1)
|
1 / 1 |
| P29317 | Ephrin type-A receptor 2 | Eph | CHEMBL13045 |
CHEMBL2219038
(1)
CHEMBL2219039
(1)
|
1 / 1 |
| P51955 | Serine/threonine-protein kinase Nek2 | Nek | CHEMBL13045 |
CHEMBL2219301
(1)
CHEMBL2219302
(1)
|
0 / 0 |
| Q15375 | Ephrin type-A receptor 7 | Eph | CHEMBL13045 |
CHEMBL2219046
(1)
CHEMBL2219047
(1)
|
0 / 0 |
| Q99683 | Mitogen-activated protein kinase kinase kinase 5 | Ste11 | CHEMBL13045 |
CHEMBL2219383
(1)
CHEMBL2218943
(1)
|
0 / 0 |
| Q9H4B4 | Serine/threonine-protein kinase PLK3 | PLK serine/threonine protein kinase subfamily | CHEMBL13045 |
CHEMBL2219143
(1)
CHEMBL2219144
(1)
|
0 / 0 |
| P54753 | Ephrin type-B receptor 3 | Eph | CHEMBL13045 |
CHEMBL2219054
(1)
CHEMBL2219055
(1)
|
0 / 0 |
| Q9UM73 | ALK tyrosine kinase receptor | TKL serine/threonine protein kinase STKR type 1 subfamily | CHEMBL13045 |
CHEMBL2219373
(1)
CHEMBL2219374
(1)
|
1 / 1 |
| O15146 | Muscle, skeletal receptor tyrosine-protein kinase | Musk | CHEMBL13045 |
CHEMBL2219297
(1)
CHEMBL2219298
(1)
|
1 / 1 |
| O60285 | NUAK family SNF1-like kinase 1 | CAMK serine/threonine protein kinase NUAK subfamily | CHEMBL13045 |
CHEMBL2219381
(1)
CHEMBL2219382
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL13045 |
CHEMBL1738610
(1)
|
0 / 0 |
| Q9NPD5 | Solute carrier organic anion transporter family member 1B3 | Electrochemical transporter | CHEMBL13045 |
CHEMBL2169430
(1)
|
1 / 0 |
| P11021 | 78 kDa glucose-regulated protein | Unclassified protein | CHEMBL13045 |
CHEMBL1963893
(1)
|
0 / 0 |
| Q96RG2 | PAS domain-containing serine/threonine-protein kinase | Pask | CHEMBL13045 |
CHEMBL2219369
(1)
CHEMBL2219370
(1)
|
0 / 0 |
| P34947 | G protein-coupled receptor kinase 5 | AGC serine/threonine protein kinase GRK subfamily | CHEMBL13045 |
CHEMBL2219088
(1)
CHEMBL2219089
(1)
|
0 / 0 |
| P06213 | Insulin receptor | TK tyrosine-protein kinase INSR subfamily | CHEMBL13045 |
CHEMBL2219215
(1)
CHEMBL2219216
(1)
CHEMBL2219217 (1) CHEMBL2219218 (1) |
5 / 4 |
| P09619 | Platelet-derived growth factor receptor beta | Pdgfr | CHEMBL13045 |
CHEMBL2219386
(1)
CHEMBL2219387
(1)
|
5 / 1 |
| P52564 | Dual specificity mitogen-activated protein kinase kinase 6 | Ste7 | CHEMBL13045 |
CHEMBL2219267
(1)
CHEMBL2219268
(1)
|
0 / 0 |
| P48730 | Casein kinase I isoform delta | Ck1 | CHEMBL13045 |
CHEMBL2218996
(1)
CHEMBL2218997
(1)
|
1 / 0 |
| P12931 | Proto-oncogene tyrosine-protein kinase Src | Src | CHEMBL13045 |
CHEMBL2219341
(1)
CHEMBL2219342
(1)
|
0 / 0 |
| O15111 | Inhibitor of nuclear factor kappa-B kinase subunit alpha | Other serine/threonine protein kinase | CHEMBL13045 |
CHEMBL2219211
(1)
CHEMBL2219212
(1)
|
1 / 1 |
| Q96GD4 | Aurora kinase B | Aur | CHEMBL13045 |
CHEMBL2218950
(1)
CHEMBL2218951
(1)
|
0 / 0 |
| O75676 | Ribosomal protein S6 kinase alpha-4 | CAMK serine/threonine protein kinase MSKB subfamily | CHEMBL13045 |
CHEMBL2219281
(1)
CHEMBL2219282
(1)
|
0 / 0 |
| P05129 | Protein kinase C gamma type | Alpha | CHEMBL13045 |
CHEMBL2219404
(1)
CHEMBL2219405
(1)
|
1 / 1 |
| O60674 | Tyrosine-protein kinase JAK2 | Jakb | CHEMBL13045 |
CHEMBL2219227
(1)
CHEMBL2219228
(1)
|
5 / 2 |
| P35968 | Vascular endothelial growth factor receptor 2 | Vegfr | CHEMBL13045 |
CHEMBL2219237
(1)
CHEMBL2219238
(1)
|
1 / 0 |
| P49137 | MAP kinase-activated protein kinase 2 | CAMK serine/threonine protein kinase MAPKAPK | CHEMBL13045 |
CHEMBL2219255
(1)
CHEMBL2219256
(1)
|
0 / 0 |
| P18054 | Arachidonate 12-lipoxygenase, 12S-type | Enzyme | CHEMBL13045 |
CHEMBL1614252
(1)
|
2 / 0 |
| P08581 | Hepatocyte growth factor receptor | TK tyrosine-protein kinase MET subfamily | CHEMBL13045 |
CHEMBL2219293
(1)
CHEMBL2219294
(1)
|
2 / 3 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL13045 |
CHEMBL1613808
(1)
CHEMBL2219253
(1)
CHEMBL2219254 (1) |
0 / 0 |
| P35916 | Vascular endothelial growth factor receptor 3 | Vegfr | CHEMBL13045 |
CHEMBL2219080
(1)
CHEMBL2219081
(1)
|
2 / 1 |
| P22455 | Fibroblast growth factor receptor 4 | Fgfr | CHEMBL13045 |
CHEMBL2219068
(1)
CHEMBL2219069
(1)
|
0 / 0 |
| P22607 | Fibroblast growth factor receptor 3 | Fgfr | CHEMBL13045 |
CHEMBL2219066
(1)
CHEMBL2219067
(1)
|
14 / 6 |
| P45983 | Mitogen-activated protein kinase 8 | Jnk | CHEMBL13045 |
CHEMBL2219231
(1)
CHEMBL2219232
(1)
|
0 / 0 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL13045 |
CHEMBL1741322
(1)
|
0 / 0 |
| O94804 | Serine/threonine-protein kinase 10 | STE serine/threonine protein kinase SLK subfamily | CHEMBL13045 |
CHEMBL2219243
(1)
CHEMBL2219244
(1)
|
1 / 0 |
| P53667 | LIM domain kinase 1 | Limk | CHEMBL13045 |
CHEMBL2219239
(1)
CHEMBL2219240
(1)
|
0 / 0 |
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL13045 |
CHEMBL1613910
(1)
CHEMBL1614227
(1)
|
3 / 3 |
| Q13177 | Serine/threonine-protein kinase PAK 2 | STE serine/threonine protein kinase PAKA subfamily | CHEMBL13045 |
CHEMBL2219357
(1)
CHEMBL2219358
(1)
|
0 / 0 |
| Q06418 | Tyrosine-protein kinase receptor TYRO3 | TK tyrosine-protein kinase AXL | CHEMBL13045 |
CHEMBL2219161
(1)
CHEMBL2219162
(1)
|
0 / 0 |
| Q6PHR2 | Serine/threonine-protein kinase ULK3 | ULK serine/threonine protein kinase | CHEMBL13045 |
CHEMBL2219323
(1)
CHEMBL2219324
(1)
|
0 / 0 |
| Q7L7X3 | Serine/threonine-protein kinase TAO1 | STE serine/threonine protein kinase TAO subfamily | CHEMBL13045 |
CHEMBL2219199
(1)
CHEMBL2219200
(1)
|
0 / 0 |
| P14616 | Insulin receptor-related protein | TK tyrosine-protein kinase INSR | CHEMBL13045 |
CHEMBL2219223
(1)
CHEMBL2219224
(1)
|
0 / 0 |
| O43318 | Mitogen-activated protein kinase kinase kinase 7 | Tak1 | CHEMBL13045 |
CHEMBL2219197
(1)
CHEMBL2219198
(1)
|
0 / 0 |
| Q9BXA7 | Testis-specific serine/threonine-protein kinase 1 | Tssk | CHEMBL13045 |
CHEMBL2219307
(1)
CHEMBL2219308
(1)
|
0 / 0 |
| Q9H2K8 | Serine/threonine-protein kinase TAO3 | STE serine/threonine protein kinase TAO subfamily | CHEMBL13045 |
CHEMBL2219203
(1)
CHEMBL2219204
(1)
|
0 / 0 |
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL13045 |
CHEMBL1614038
(1)
|
2 / 2 |
| O15118 | Niemann-Pick C1 protein | Unclassified protein | CHEMBL13045 |
CHEMBL1614342
(1)
|
1 / 1 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL13045 |
CHEMBL1737868
(1)
|
0 / 0 |
| Q8NG66 | Serine/threonine-protein kinase Nek11 | Nek11 | CHEMBL13045 |
CHEMBL2219299
(1)
CHEMBL2219300
(1)
|
0 / 0 |
| Q8WTQ7 | G protein-coupled receptor kinase 7 | AGC serine/threonine protein kinase GRK subfamily | CHEMBL13045 |
CHEMBL2219092
(1)
CHEMBL2219093
(1)
|
0 / 0 |
| Q8TF76 | Serine/threonine-protein kinase haspin | Haspin | CHEMBL13045 |
CHEMBL2219104
(1)
CHEMBL2219105
(1)
|
0 / 0 |
| P11362 | Fibroblast growth factor receptor 1 | Fgfr | CHEMBL13045 |
CHEMBL2219062
(1)
CHEMBL2219063
(1)
|
4 / 5 |
| P53350 | Serine/threonine-protein kinase PLK1 | PLK serine/threonine protein kinase subfamily | CHEMBL13045 |
CHEMBL2219141
(1)
CHEMBL2219142
(1)
|
0 / 0 |
| Q08881 | Tyrosine-protein kinase ITK/TSK | Tec | CHEMBL13045 |
CHEMBL2219225
(1)
CHEMBL2219226
(1)
|
1 / 1 |
| P49840 | Glycogen synthase kinase-3 alpha | Gsk | CHEMBL13045 |
CHEMBL2219094
(1)
CHEMBL2219095
(1)
|
0 / 0 |
| Q13976 | cGMP-dependent protein kinase 1 | Pkg | CHEMBL13045 |
CHEMBL2219123
(1)
CHEMBL2219124
(1)
CHEMBL2219125 (1) CHEMBL2219126 (1) |
0 / 0 |
| Q8IW41 | MAP kinase-activated protein kinase 5 | CAMK serine/threonine protein kinase MAPKAPK | CHEMBL13045 |
CHEMBL2219127
(1)
CHEMBL2219128
(1)
|
0 / 0 |
| O75116 | Rho-associated protein kinase 2 | Rock | CHEMBL13045 |
CHEMBL2219153
(1)
CHEMBL2219154
(1)
|
0 / 0 |
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL13045 |
CHEMBL1614274
(1)
CHEMBL1613823
(1)
|
0 / 0 |
| P05771 | Protein kinase C beta type | Alpha | CHEMBL13045 |
CHEMBL2219400
(1)
CHEMBL2219401
(1)
CHEMBL2219402 (1) CHEMBL2219403 (1) |
0 / 0 |
| P08631 | Tyrosine-protein kinase HCK | Src | CHEMBL13045 |
CHEMBL2219106
(1)
CHEMBL2219107
(1)
CHEMBL2219108 (1) CHEMBL2219109 (1) |
0 / 0 |
| P07948 | Tyrosine-protein kinase Lyn | Src | CHEMBL13045 |
CHEMBL2219249
(1)
CHEMBL2219250
(1)
|
0 / 0 |
| P16050 | Arachidonate 15-lipoxygenase | Enzyme | CHEMBL13045 |
CHEMBL1614240
(1)
|
0 / 0 |
| P31749 | RAC-alpha serine/threonine-protein kinase | Akt | CHEMBL13045 |
CHEMBL2219392
(1)
CHEMBL2219393
(1)
|
4 / 1 |
| O00141 | Serine/threonine-protein kinase Sgk1 | AGC serine/threonine protein kinase SGK subfamily | CHEMBL13045 |
CHEMBL2219179
(1)
CHEMBL2219180
(1)
|
0 / 0 |
| P51812 | Ribosomal protein S6 kinase alpha-3 | Rskb | CHEMBL13045 |
CHEMBL2219165
(1)
CHEMBL2219166
(1)
|
2 / 2 |
| P07333 | Macrophage colony-stimulating factor 1 receptor | Pdgfr | CHEMBL13045 |
CHEMBL2219082
(1)
CHEMBL2219083
(1)
|
1 / 1 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL13045 |
CHEMBL1613777
(1)
CHEMBL1741323
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL13045 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
CHEMBL1741324 (1) |
0 / 1 |
| P16591 | Tyrosine-protein kinase Fer | Fer | CHEMBL13045 |
CHEMBL2219070
(1)
CHEMBL2219071
(1)
|
0 / 0 |
| Q8IU85 | Calcium/calmodulin-dependent protein kinase type 1D | Camk1 | CHEMBL13045 |
CHEMBL2219018
(1)
CHEMBL2219019
(1)
|
0 / 0 |
| Q9HC98 | Serine/threonine-protein kinase Nek6 | Nek | CHEMBL13045 |
CHEMBL2219351
(1)
CHEMBL2219352
(1)
|
0 / 0 |
| Q9UEE5 | Serine/threonine-protein kinase 17A | Dapk | CHEMBL13045 |
CHEMBL2219030
(1)
CHEMBL2219031
(1)
|
0 / 0 |
| P07949 | Proto-oncogene tyrosine-protein kinase receptor Ret | Ret | CHEMBL13045 |
CHEMBL2219155
(1)
CHEMBL2219156
(1)
|
9 / 5 |
| Q9H2X6 | Homeodomain-interacting protein kinase 2 | CMGC dual-specificity kinase HIPK | CHEMBL13045 |
CHEMBL2219100
(1)
CHEMBL2219101
(1)
|
0 / 0 |
| P36896 | Activin receptor type-1B | TKL serine/threonine protein kinase STKR type 1 subfamily | CHEMBL13045 |
CHEMBL2219375
(1)
CHEMBL2219376
(1)
|
0 / 0 |
| Q86UE8 | Serine/threonine-protein kinase tousled-like 2 | TLK serine/threonine protein kinase | CHEMBL13045 |
CHEMBL2219305
(1)
CHEMBL2219306
(1)
|
0 / 0 |
| Q86Z02 | Homeodomain-interacting protein kinase 1 | CMGC serine/threonine protein kinase HIPK subfamily | CHEMBL13045 |
CHEMBL2219098
(1)
CHEMBL2219099
(1)
|
0 / 0 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL13045 |
CHEMBL1614211
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL13045 |
CHEMBL1614250
(1)
CHEMBL1614421
(2)
CHEMBL1614502 (2) |
4 / 3 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL13045 |
CHEMBL1737980
(1)
|
0 / 0 |
| P10721 | Mast/stem cell growth factor receptor Kit | Pdgfr | CHEMBL13045 |
CHEMBL2219339
(1)
CHEMBL2219340
(1)
|
4 / 4 |
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL13045 |
CHEMBL2219245
(1)
CHEMBL2219246
(1)
CHEMBL2219247 (1) CHEMBL2219248 (1) |
0 / 1 |
| Q9HCP0 | Casein kinase I isoform gamma-1 | Ck1 | CHEMBL13045 |
CHEMBL2218990
(1)
CHEMBL2218991
(1)
|
0 / 0 |
| Q13554 | Calcium/calmodulin-dependent protein kinase type II subunit beta | Camk2 | CHEMBL13045 |
CHEMBL2219010
(1)
CHEMBL2219011
(1)
|
0 / 0 |
| O96017 | Serine/threonine-protein kinase Chk2 | Rad53 | CHEMBL13045 |
CHEMBL2218988
(1)
CHEMBL2218989
(1)
|
4 / 1 |
| P52333 | Tyrosine-protein kinase JAK3 | Jakb | CHEMBL13045 |
CHEMBL2219229
(1)
CHEMBL2219230
(1)
|
1 / 1 |
| P04049 | RAF proto-oncogene serine/threonine-protein kinase | Raf | CHEMBL13045 |
CHEMBL2219337
(1)
CHEMBL2219338
(1)
|
2 / 0 |
| P43405 | Tyrosine-protein kinase SYK | Syk | CHEMBL13045 |
CHEMBL2219195
(1)
CHEMBL2219196
(1)
|
0 / 0 |
| Q14012 | Calcium/calmodulin-dependent protein kinase type 1 | Camk1 | CHEMBL13045 |
CHEMBL2219008
(1)
CHEMBL2219009
(1)
|
0 / 0 |
| Q16566 | Calcium/calmodulin-dependent protein kinase type IV | Camk1 | CHEMBL13045 |
CHEMBL2219016
(1)
CHEMBL2219017
(1)
|
0 / 0 |
| P53355 | Death-associated protein kinase 1 | Dapk | CHEMBL13045 |
CHEMBL2219020
(1)
CHEMBL2219021
(1)
|
0 / 1 |
| P24723 | Protein kinase C eta type | Eta | CHEMBL13045 |
CHEMBL2219113
(1)
CHEMBL2219114
(1)
|
1 / 0 |
| P51451 | Tyrosine-protein kinase Blk | Src | CHEMBL13045 |
CHEMBL2218960
(1)
CHEMBL2218961
(1)
|
1 / 1 |
| P17612 | cAMP-dependent protein kinase catalytic subunit alpha | Pka | CHEMBL13045 |
CHEMBL2219390
(1)
CHEMBL2219391
(1)
|
0 / 0 |
| O14733 | Dual specificity mitogen-activated protein kinase kinase 7 | Ste7 | CHEMBL13045 |
CHEMBL2219269
(1)
CHEMBL2219270
(1)
|
0 / 0 |
| P53778 | Mitogen-activated protein kinase 12 | p38 | CHEMBL13045 |
CHEMBL2219175
(1)
CHEMBL2219176
(1)
|
0 / 0 |
| O00418 | Eukaryotic elongation factor 2 kinase | Atypical serine/threonine protein kinase alpha subfamily | CHEMBL13045 |
CHEMBL2219343
(1)
CHEMBL2219344
(1)
|
0 / 0 |
| P35557 | Glucokinase | Enzyme | CHEMBL13045 |
CHEMBL2219086
(1)
CHEMBL2219087
(1)
|
3 / 3 |
| P49760 | Dual specificity protein kinase CLK2 | Clk | CHEMBL13045 |
CHEMBL2219002
(1)
CHEMBL2219003
(1)
|
0 / 0 |
| P54756 | Ephrin type-A receptor 5 | Eph | CHEMBL13045 |
CHEMBL2219044
(1)
CHEMBL2219045
(1)
|
0 / 0 |
| P54762 | Ephrin type-B receptor 1 | Eph | CHEMBL13045 |
CHEMBL2219050
(1)
CHEMBL2219051
(1)
|
0 / 0 |
| Q07912 | Activated CDC42 kinase 1 | TK tyrosine-protein kinase ACK subfamily | CHEMBL13045 |
CHEMBL2219371
(1)
CHEMBL2219372
(1)
|
0 / 0 |
| P30530 | Tyrosine-protein kinase receptor UFO | TK tyrosine-protein kinase AXL subfamily | CHEMBL13045 |
CHEMBL2218954
(1)
CHEMBL2218955
(1)
|
0 / 0 |
| Q9BZL6 | Serine/threonine-protein kinase D2 | Pkd | CHEMBL13045 |
CHEMBL2219121
(1)
CHEMBL2219122
(1)
|
0 / 0 |
| Q86V86 | Serine/threonine-protein kinase pim-3 | Pim | CHEMBL13045 |
CHEMBL2219139
(1)
CHEMBL2219140
(1)
|
0 / 0 |
| Q9UPE1 | SRSF protein kinase 3 | Srpk | CHEMBL13045 |
CHEMBL2219283
(1)
CHEMBL2219284
(1)
|
0 / 0 |
| Q9Y6E0 | Serine/threonine-protein kinase 24 | STE serine/threonine protein kinase YSK subfamily | CHEMBL13045 |
CHEMBL2219289
(1)
CHEMBL2219290
(1)
|
0 / 0 |
| Q9Y6M4 | Casein kinase I isoform gamma-3 | Ck1-g | CHEMBL13045 |
CHEMBL2218994
(1)
CHEMBL2218995
(1)
|
0 / 0 |
| Q8N568 | Serine/threonine-protein kinase DCLK2 | CAMK serine/threonine protein kinase DCAMK1 | CHEMBL13045 |
CHEMBL2219024
(1)
CHEMBL2219025
(1)
|
0 / 0 |
| Q8TDC3 | Serine/threonine-protein kinase BRSK1 | CAMK serine/threonine protein kinase BRSK subfamily | CHEMBL13045 |
CHEMBL2218964
(1)
CHEMBL2218965
(1)
|
0 / 0 |
| P51817 | cAMP-dependent protein kinase catalytic subunit PRKX | Pka | CHEMBL13045 |
CHEMBL2219145
(1)
CHEMBL2219146
(1)
|
0 / 0 |
| P40225 | Thrombopoietin | Unclassified protein | CHEMBL13045 |
CHEMBL1614086
(1)
CHEMBL1614034
(1)
|
1 / 1 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL13045 |
CHEMBL1738442
(1)
|
0 / 0 |
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL13045 |
CHEMBL1614364
(1)
|
1 / 1 |
| Q9UL54 | Serine/threonine-protein kinase TAO2 | STE serine/threonine protein kinase TAO subfamily | CHEMBL13045 |
CHEMBL2219201
(1)
CHEMBL2219202
(1)
|
0 / 0 |
| O00255 | Menin | Unclassified protein | CHEMBL13045 |
CHEMBL1614257
(2)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL13045 |
CHEMBL1614257
(2)
|
1 / 3 |
| P51946 | Cyclin-H | Other cytosolic protein | CHEMBL13045 |
CHEMBL2218982
(1)
CHEMBL2218983
(1)
|
0 / 0 |
| P50613 | Cyclin-dependent kinase 7 | Cdk7 | CHEMBL13045 |
CHEMBL2218982
(1)
CHEMBL2218983
(1)
|
0 / 0 |
| P24864 | G1/S-specific cyclin-E1 | Other cytosolic protein | CHEMBL13045 |
CHEMBL2218972
(1)
CHEMBL2218973
(1)
CHEMBL2218974 (1) CHEMBL2218975 (1) |
0 / 2 |
| P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL13045 |
CHEMBL2218970
(1)
CHEMBL2218971
(1)
CHEMBL2218972 (1) CHEMBL2218973 (1) |
0 / 0 |
| O96020 | G1/S-specific cyclin-E2 | Other cytosolic protein | CHEMBL13045 |
CHEMBL2218972
(1)
CHEMBL2218973
(1)
CHEMBL2218974 (1) CHEMBL2218975 (1) |
0 / 2 |
| O95067 | G2/mitotic-specific cyclin-B2 | Other cytosolic protein | CHEMBL13045 |
CHEMBL2218968
(1)
CHEMBL2218969
(1)
|
0 / 0 |
| P14635 | G2/mitotic-specific cyclin-B1 | Other cytosolic protein | CHEMBL13045 |
CHEMBL2218968
(1)
CHEMBL2218969
(1)
|
0 / 0 |
| P06493 | Cyclin-dependent kinase 1 | Cdc2 | CHEMBL13045 |
CHEMBL2218968
(1)
CHEMBL2218969
(1)
|
0 / 0 |
| Q8WWL7 | G2/mitotic-specific cyclin-B3 | Other cytosolic protein | CHEMBL13045 |
CHEMBL2218968
(1)
CHEMBL2218969
(1)
|
0 / 0 |
| P20248 | Cyclin-A2 | Other cytosolic protein | CHEMBL13045 |
CHEMBL2218970
(1)
CHEMBL2218971
(1)
|
0 / 0 |
| P78396 | Cyclin-A1 | Other cytosolic protein | CHEMBL13045 |
CHEMBL2218970
(1)
CHEMBL2218971
(1)
|
0 / 0 |
| P68400 | Casein kinase II subunit alpha | Ck2 | CHEMBL13045 |
CHEMBL2218998
(1)
CHEMBL2218999
(1)
|
0 / 0 |
| P67870 | Casein kinase II subunit beta | REG serine/threonine protein kinase family | CHEMBL13045 |
CHEMBL2218998
(1)
CHEMBL2218999
(1)
|
0 / 0 |
| P54619 | 5'-AMP-activated protein kinase subunit gamma-1 | REG serine/threonine protein kinase family | CHEMBL13045 |
CHEMBL2219377
(1)
CHEMBL2219378
(1)
CHEMBL2219379 (1) CHEMBL2219380 (1) |
0 / 0 |
| Q9Y478 | 5'-AMP-activated protein kinase subunit beta-1 | REG serine/threonine protein kinase family | CHEMBL13045 |
CHEMBL2219377
(1)
CHEMBL2219378
(1)
CHEMBL2219379 (1) CHEMBL2219380 (1) |
0 / 0 |
| P54646 | 5'-AMP-activated protein kinase catalytic subunit alpha-2 | Ampk | CHEMBL13045 |
CHEMBL2219379
(1)
CHEMBL2219380
(1)
|
0 / 0 |
| Q13131 | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | Ampk | CHEMBL13045 |
CHEMBL2219377
(1)
CHEMBL2219378
(1)
CHEMBL2219379 (1) CHEMBL2219380 (1) |
0 / 0 |
| O43741 | 5'-AMP-activated protein kinase subunit beta-2 | REG serine/threonine protein kinase family | CHEMBL13045 |
CHEMBL2219379
(1)
CHEMBL2219380
(1)
|
0 / 0 |
| Q9UGJ0 | 5'-AMP-activated protein kinase subunit gamma-2 | REG serine/threonine protein kinase family | CHEMBL13045 |
CHEMBL2219379
(1)
CHEMBL2219380
(1)
|
3 / 3 |
| O60563 | Cyclin-T1 | Other cytosolic protein | CHEMBL13045 |
CHEMBL2218984
(1)
CHEMBL2218985
(1)
|
0 / 0 |
| P50750 | Cyclin-dependent kinase 9 | Cdk9 | CHEMBL13045 |
CHEMBL2218984
(1)
CHEMBL2218985
(1)
|
0 / 0 |
| Q00526 | Cyclin-dependent kinase 3 | Cdc2 | CHEMBL13045 |
CHEMBL2218974
(1)
CHEMBL2218975
(1)
|
0 / 0 |
| Q00534 | Cyclin-dependent kinase 6 | CMGC serine/threonine protein kinase family | CHEMBL13045 |
CHEMBL2218980
(1)
CHEMBL2218981
(1)
|
1 / 0 |
| P30281 | G1/S-specific cyclin-D3 | Other cytosolic protein | CHEMBL13045 |
CHEMBL2218980
(1)
CHEMBL2218981
(1)
|
0 / 1 |
| P62942 | Peptidyl-prolyl cis-trans isomerase FKBP1A | Isomerase | CHEMBL13045 |
CHEMBL2219347
(1)
CHEMBL2219348
(1)
|
0 / 0 |
| Q9UGI9 | 5'-AMP-activated protein kinase subunit gamma-3 | Kinase | CHEMBL13045 |
CHEMBL2219379
(1)
CHEMBL2219380
(1)
|
0 / 0 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C016299 | 846 |
CASR
CAR EIG8 FHH FIH GPRC2A HHC HHC1 HYPOC1 NSHPT PCAR1 |
calcium-sensing receptor | chelerythrine inhibits the reaction [CASR protein results in increased uptake of Calcium] |
decreases reaction
/ increases uptake |
protein |
21562303
|
| C016299 | 1080 |
CFTR
ABC35 ABCC7 CF CFTR/MRP MRP7 TNR-CFTR dJ760C5.1 |
cystic fibrosis transmembrane conductance regulator (ATP-binding cassette sub-family C, member 7) (EC:3.6.3.49) | chelerythrine results in decreased activity of CFTR protein |
decreases activity
|
protein |
14744818
|
| C016299 | 1950 |
EGF
HOMG4 URG |
epidermal growth factor | chelerythrine inhibits the reaction [EGF protein inhibits the reaction [Acetaldehyde affects the localization of TJP1 protein]] |
affects localization
/ decreases reaction |
protein |
17991733
|
| C016299 | 1950 |
EGF
HOMG4 URG |
epidermal growth factor | chelerythrine inhibits the reaction [EGF protein results in decreased susceptibility to Acetaldehyde] |
decreases reaction
/ decreases response to substance |
protein |
17991733
|
| C016299 | 2335 |
FN1
CIG ED-B FINC FN FNZ GFND GFND2 LETS MSF |
fibronectin 1 | chelerythrine inhibits the reaction [Glucose results in increased expression of FN1 protein] |
decreases reaction
/ increases expression |
protein |
12388107
|
| C016299 | 3569 |
IL6
BSF2 HGF HSF IFNB2 IL-6 |
interleukin 6 (interferon, beta 2) | chelerythrine inhibits the reaction [Acids results in increased expression of IL6 mRNA] |
decreases reaction
/ increases expression |
mRNA |
19074641
|
| C016299 | 3569 |
IL6
BSF2 HGF HSF IFNB2 IL-6 |
interleukin 6 (interferon, beta 2) | chelerythrine inhibits the reaction [Acids results in increased secretion of IL6 protein] |
decreases reaction
/ increases secretion |
protein |
19074641
|
| C016299 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | [AG 1879 co-treated with chelerythrine] inhibits the reaction [IL8 protein results in increased secretion of MMP9 protein] |
affects cotreatment
/ decreases reaction / increases secretion |
protein |
15831558
|
| C016299 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | chelerythrine inhibits the reaction [Acids results in increased expression of IL8 mRNA] |
decreases reaction
/ increases expression |
mRNA |
19074641
|
| C016299 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | chelerythrine inhibits the reaction [Acids results in increased secretion of IL8 protein] |
decreases reaction
/ increases secretion |
protein |
19074641
|
| C016299 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | chelerythrine inhibits the reaction [IL8 protein results in increased phosphorylation of MAPK1 protein] |
decreases reaction
/ increases phosphorylation |
protein |
15831558
|
| C016299 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | chelerythrine inhibits the reaction [IL8 protein results in increased phosphorylation of MAPK3 protein] |
decreases reaction
/ increases phosphorylation |
protein |
15831558
|
| C016299 | 3752 |
KCND3
KCND3L KCND3S KSHIVB KV4.3 SCA19 SCA22 |
potassium voltage-gated channel, Shal-related subfamily, member 3 | chelerythrine inhibits the reaction [Phenylephrine results in decreased activity of KCND3 protein alternative form] |
decreases activity
/ decreases reaction |
protein |
11709419
|
| C016299 | 5594 |
MAPK1
ERK ERK2 ERT1 MAPK2 P42MAPK PRKM1 PRKM2 p38 p40 p41 p41mapk |
mitogen-activated protein kinase 1 (EC:2.7.11.24) | chelerythrine inhibits the reaction [IL8 protein results in increased phosphorylation of MAPK1 protein] |
decreases reaction
/ increases phosphorylation |
protein |
15831558
|
| C016299 | 5595 |
MAPK3
ERK-1 ERK1 ERT2 HS44KDAP HUMKER1A P44ERK1 P44MAPK PRKM3 p44-ERK1 p44-MAPK |
mitogen-activated protein kinase 3 (EC:2.7.11.24) | chelerythrine inhibits the reaction [IL8 protein results in increased phosphorylation of MAPK3 protein] |
decreases reaction
/ increases phosphorylation |
protein |
15831558
|
| C016299 | 4318 |
MMP9
CLG4B GELB MANDP2 MMP-9 |
matrix metallopeptidase 9 (gelatinase B, 92kDa gelatinase, 92kDa type IV collagenase) (EC:3.4.24.35) | [AG 1879 co-treated with chelerythrine] inhibits the reaction [IL8 protein results in increased secretion of MMP9 protein] |
affects cotreatment
/ decreases reaction / increases secretion |
protein |
15831558
|
| C016299 | 5581 |
PRKCE
PKCE nPKC-epsilon |
protein kinase C, epsilon (EC:2.7.11.13) | chelerythrine inhibits the reaction [Calcium results in increased phosphorylation of PRKCE protein] |
decreases reaction
/ increases phosphorylation |
protein |
21562303
|
| C016299 | 5970 |
RELA
NFKB3 p65 |
v-rel avian reticuloendotheliosis viral oncogene homolog A | chelerythrine inhibits the reaction [Acids results in increased activity of RELA protein] |
decreases reaction
/ increases activity |
protein |
19074641
|
| C016299 | 5970 |
RELA
NFKB3 p65 |
v-rel avian reticuloendotheliosis viral oncogene homolog A | chelerythrine inhibits the reaction [Glucose results in increased activity of RELA protein] |
decreases reaction
/ increases activity |
protein |
12388107
|
| C016299 | 8884 |
SLC5A6
SMVT |
solute carrier family 5 (sodium/multivitamin and iodide cotransporter), member 6 | chelerythrine inhibits the reaction [SLC5A6 protein results in increased transport of Biotin] |
decreases reaction
/ increases transport |
protein |
15561972
|
| C016299 | 7082 |
TJP1
ZO-1 |
tight junction protein 1 | chelerythrine inhibits the reaction [EGF protein inhibits the reaction [Acetaldehyde affects the localization of TJP1 protein]] |
affects localization
/ decreases reaction |
protein |
17991733
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency |
Q99714
|
| #100800 | Achondroplasia; ach |
P22607
|
| #202300 | Adrenocortical carcinoma, hereditary; adcc |
P04637
|
| #615224 | Advanced sleep phase syndrome, familial, 2; fasps2 |
P48730
|
| #300755 | Agammaglobulinemia, x-linked; xla |
Q06187
|
| #207410 | Antley-bixler syndrome without genital anomalies or disordered steroidogenesis; abs2 |
P21802
|
| #613780 | Aortic aneurysm, familial thoracic 7; aat7 |
Q15746
|
| #101200 | Apert syndrome |
P21802
|
| #614740 | Basal cell carcinoma, susceptibility to, 7; bcc7 |
P04637
|
| #615007 | Basal ganglia calcification, idiopathic, 4; ibgc4 |
P09619
|
| #123790 | Beare-stevenson cutis gyrata syndrome; bstvs |
P21802
|
| #614592 | Bent bone dysplasia syndrome; bbds |
P21802
|
| #109800 | Bladder cancer |
P22607
|
| #114480 | Breast cancer |
O96017
P31749 |
| #600880 | Budd-chiari syndrome; bdchs |
O60674
|
| #610474 | Camptodactyly, tall stature, and hearing loss syndrome |
P22607
|
| #615279 | Cardiofaciocutaneous syndrome 3; cfc3 |
Q02750
|
| #600858 | Cardiomyopathy, familial hypertrophic, 6; cmh6 |
Q9UGJ0
|
| #116600 | Cataract 6, multiple types; ctrct6 |
P29317
|
| #209880 | Central hypoventilation syndrome, congenital; cchs |
P07949
|
| #603956 | Cervical cancer |
P22607
|
| #613630 | Cocoon syndrome |
O15111
|
| #303600 | Coffin-lowry syndrome; cls |
P51812
|
| #114500 | Colorectal cancer; crc |
P07949
P18054 P29320 P31749 |
| #615109 | Cowden syndrome 6; cws6 |
P31749
|
| #123500 | Crouzon syndrome |
P21802
|
| #612247 | Crouzon syndrome with acanthosis nigricans; can |
P22607
|
| #610549 | Diabetes mellitus, insulin-resistant, with acanthosis nigricans |
P06213
|
| #125853 | Diabetes mellitus, noninsulin-dependent; niddm |
P06213
P31751 |
| #119900 | Digital clubbing, isolated congenital |
P15428
|
| #246200 | Donohue syndrome |
P06213
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #133239 | Esophageal cancer |
P04637
P18054 |
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #606764 | Gastrointestinal stromal tumor; gist |
P10721
P16234 |
| #177700 | Glaucoma 1, open angle, p; glc1p |
Q9UHD2
|
| #613027 | Glycogen storage disease ixc; gsd9c |
P15735
|
| #261740 | Glycogen storage disease of heart, lethal congenital |
Q9UGJ0
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #602089 | Hemangioma, capillary infantile |
P35916
P35968 |
| #114550 | Hepatocellular carcinoma |
P08581
|
| #142623 | Hirschsprung disease, susceptibility to, 1; hscr1 |
P07949
|
| #237450 | Hyperbilirubinemia, rotor type; hblrr |
Q9NPD5
Q9Y6L6 |
| #607685 | Hypereosinophilic syndrome, idiopathic; hes |
P16234
|
| #602485 | Hyperinsulinemic hypoglycemia, familial, 3; hhf3 |
P35557
|
| #609968 | Hyperinsulinemic hypoglycemia, familial, 5; hhf5 |
P06213
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #603373 | Hyperthyroidism, familial gestational |
P16473
|
| #609152 | Hyperthyroidism, nonautoimmune |
P16473
|
| #259100 | Hypertrophic osteoarthropathy, primary, autosomal recessive, 1; phoar1 |
P15428
|
| #146000 | Hypochondroplasia; hch |
P22607
|
| #147950 | Hypogonadotropic hypogonadism 2 with or without anosmia; hh2 |
P11362
|
| #240900 | Hypoinsulinemic hypoglycemia with hemihypertrophy; hihghh |
P31751
|
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 |
P16473
|
| #256800 | Insensitivity to pain, congenital, with anhidrosis; cipa |
P04629
|
| #270450 | Insulin-like growth factor i, resistance to |
P08069
|
| #610799 | Invasive pneumococcal disease, recurrent isolated, 1; ipd1 |
Q9NWZ3
|
| #607676 | Irak4 deficiency |
Q9NWZ3
|
| #307200 | Isolated growth hormone deficiency, type iii; ighd3 |
Q06187
|
| #123150 | Jackson-weiss syndrome; jws |
P21802
|
| #607785 | Juvenile myelomonocytic leukemia; jmml |
P09619
|
| #182000 | Keratosis, seborrheic |
P22607
|
| #149730 | Lacrimoauriculodentodigital syndrome; ladd |
P21802
P22607 |
| #611554 | Leopard syndrome 2 |
P04049
|
| #601626 | Leukemia, acute myeloid; aml |
O60674
P09619 P10721 P36888 |
| #608232 | Leukemia, chronic myeloid; cml |
P00519
|
| #221820 | Leukoencephalopathy, diffuse hereditary, with spheroids; hdls |
P07333
|
| #151623 | Li-fraumeni syndrome 1; lfs1 |
P04637
|
| #609265 | Li-fraumeni syndrome 2; lfs2 |
O96017
|
| #609192 | Loeys-dietz syndrome, type 1a; lds1a |
P36897
|
| #608967 | Loeys-dietz syndrome, type 2a; lds2a |
P36897
|
| #211980 | Lung cancer |
P00533
P04637 |
| #153100 | Lymphedema, hereditary, ia |
P35916
|
| #613011 | Lymphoproliferative syndrome 1; lpfs1 |
Q08881
|
| #613375 | Maturity-onset diabetes of the young, type 11; mody11 |
P51451
|
| #125851 | Maturity-onset diabetes of the young, type 2; mody2 |
P35557
|
| #606391 | Maturity-onset diabetes of the young; mody |
P35557
|
| #603387 | Megalencephaly-polymicrogyria-polydactyly-hydrocephalus syndrome; mpph |
Q9Y243
|
| #300705 | Mental retardation, x-linked 17; mrx17 |
Q99714
|
| #300844 | Mental retardation, x-linked 19; mrx19 |
P51812
|
| #300558 | Mental retardation, x-linked 30; mrx30 |
O75914
|
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 |
Q99714
|
| #602849 | Muenke syndrome; mnkes |
P22607
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #171400 | Multiple endocrine neoplasia, type iia; men2a |
P07949
|
| #162300 | Multiple endocrine neoplasia, type iib; men2b |
P07949
|
| #132800 | Multiple self-healing squamous epithelioma, susceptibility to; msse |
P36897
|
| #608931 | Myasthenic syndrome, congenital, associated with acetylcholine receptor deficiency |
O15146
|
| #607948 | Mycobacterium tuberculosis, susceptibility to |
P11473
|
| #254450 | Myelofibrosis |
O60674
|
| #254500 | Myeloma, multiple |
P22607
|
| #131440 | Myeloproliferative disorder, chronic, with eosinophilia |
P09619
|
| #228550 | Myofibromatosis, infantile, 1; imf1 |
P09619
|
| #160900 | Myotonic dystrophy 1; dm1 |
Q09013
|
| #613014 | Neuroblastoma, susceptibility to, 3; nblst3 |
Q9UM73
|
| #162900 | Nevus, epidermal |
P22607
|
| #257220 | Niemann-pick disease, type c1; npc1 |
O15118
|
| #611553 | Noonan syndrome 5; ns5 |
P04049
|
| #613886 | Obesity, hyperphagia, and developmental delay |
Q16620
|
| #259500 | Osteogenic sarcoma |
O96017
|
| #166250 | Osteoglophonic dysplasia; ogd |
P11362
|
| #260500 | Papilloma of choroid plexus; cpp |
P04637
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #175200 | Peutz-jeghers syndrome; pjs |
Q15831
|
| #101600 | Pfeiffer syndrome |
P11362
P21802 |
| #171300 | Pheochromocytoma |
P07949
|
| #172700 | Pick disease of brain |
P10636
|
| #172800 | Piebald trait; pbt |
P10721
|
| #262190 | Pineal hyperplasia, insulin-resistant diabetes mellitus, and somatic abnormalities |
P06213
|
| #263300 | Polycythemia vera; pv |
O60674
|
| #176807 | Prostate cancer |
O96017
P29323 |
| #603688 | Prostate cancer/brain cancer susceptibility |
P29323
|
| #176920 | Proteus syndrome |
P31749
|
| #191830 | Renal adysplasia |
P07949
|
| #605074 | Renal cell carcinoma, papillary, 1; rccp1 |
P08581
|
| #613862 | Retinitis pigmentosa 38; rp38 |
Q12866
|
| #609579 | Scaphocephaly, maxillary retrusion, and mental retardation |
P21802
|
| #604906 | Schizophrenia 9; sczd9 |
P49798
|
| #181500 | Schizophrenia; sczd |
P49798
|
| #269840 | Selective t-cell defect; stcd |
P43403
|
| #600802 | Severe combined immunodeficiency, autosomal recessive, t cell-negative, b cell-positive, nk cell-negative |
P52333
|
| #243060 | Spermatogenic failure 5; spgf5 |
Q9UQB9
|
| #253300 | Spinal muscular atrophy, type i; sma1 |
Q16637
|
| #253550 | Spinal muscular atrophy, type ii; sma2 |
Q16637
|
| #253400 | Spinal muscular atrophy, type iii; sma3 |
Q16637
|
| #271150 | Spinal muscular atrophy, type iv; sma4 |
Q16637
|
| #605361 | Spinocerebellar ataxia 14; sca14 |
P05129
|
| #183090 | Spinocerebellar ataxia 2; sca2 |
Q99700
|
| #607250 | Spinocerebellar ataxia, autosomal recessive, with axonal neuropathy; scan1 |
Q9NUW8
|
| #271665 | Spondylometaepiphyseal dysplasia, short limb-hand type |
Q16832
|
| #275355 | Squamous cell carcinoma, head and neck; hnscc |
P04637
|
| %612223 | Stature quantitative trait locus 11; stqtl11 |
Q00534
|
| #601367 | Stroke, ischemic |
P24723
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| #614868 | T-cell immunodeficiency, recurrent infections, and autoimmunity with or without cardiac malformations; tiiac |
Q13043
|
| #273300 | Testicular germ cell tumor; tgct |
O94804
P10721 P22607 Q15831 |
| #187600 | Thanatophoric dysplasia, type i; td1 |
P22607
|
| #187601 | Thanatophoric dysplasia, type ii; td2 |
P22607
|
| #187950 | Thrombocythemia 1; thcyt1 |
P40225
|
| #614521 | Thrombocythemia 3; thcyt3 |
O60674
|
| #155240 | Thyroid carcinoma, familial medullary; mtc |
P07949
|
| #188550 | Thyroid carcinoma, papillary |
P04629
P07949 |
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth |
P10828
|
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth |
P10828
|
| #145650 | Thyroid hormone resistance, selective pituitary; prth |
P10828
|
| #190440 | Trigonocephaly 1; trigno1 |
P11362
|
| #600195 | Venous malformations, multiple cutaneous and mucosal; vmcm |
Q02763
|
| #277440 | Vitamin d-dependent rickets, type 2a; vddr2a |
P11473
|
| #194200 | Wolff-parkinson-white syndrome |
Q9UGJ0
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
P04637 (related) |
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00882 | Cocoon syndrome |
O15111
(related)
|
| H00136 | Niemann-Pick disease type C (NPC) |
O15118
(related)
|
| H00770 | Congenital myasthenic syndrome |
O15146
(related)
|
| H00012 | Polycythemia vera |
O60674
(related)
O60674 (marker) |
| H00480 | Non-syndromic X-linked mental retardation |
O75914
(related)
P51812 (related) Q99714 (related) |
| H00881 | Li-Fraumeni syndrome |
O96017
(related)
P04637 (related) |
| H00018 | Gastric cancer |
O96020
(related)
P00533 (related) P04637 (related) P08581 (related) P21802 (related) P24864 (related) |
| H00055 | Laryngeal cancer |
O96020
(related)
P00533 (related) P00533 (marker) P04637 (related) P04637 (marker) P24864 (related) |
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
P00519
(related)
P00519 (marker) Q03164 (related) Q03164 (marker) |
| H00004 | Chronic myeloid leukemia (CML) |
P00519
(related)
P00519 (marker) P04637 (related) |
| H00016 | Oral cancer |
P00533
(related)
P00533 (marker) P04637 (related) P04637 (marker) |
| H00017 | Esophageal cancer |
P00533
(related)
P04637 (related) P04637 (marker) |
| H00022 | Bladder cancer |
P00533
(related)
P04637 (related) P22607 (related) P53355 (related) |
| H00028 | Choriocarcinoma |
P00533
(related)
P04637 (related) P07333 (related) |
| H00030 | Cervical cancer |
P00533
(related)
|
| H00042 | Glioma |
P00533
(related)
P00533 (marker) P04637 (related) P04637 (marker) P09619 (related) P16234 (related) |
| H00032 | Thyroid cancer |
P04629
(related)
P04637 (related) P07949 (related) P07949 (marker) |
| H00043 | Neuroblastoma |
P04629
(related)
P04629 (marker) Q16620 (related) |
| H00265 | Hereditary sensory and autonomic neuropathy (HSAN) |
P04629
(related)
|
| H00005 | Chronic lymphocytic leukemia (CLL) |
P04637
(related)
P43403 (marker) |
| H00006 | Hairy-cell leukemia |
P04637
(related)
|
| H00008 | Burkitt lymphoma |
P04637
(related)
|
| H00009 | Adult T-cell leukemia |
P04637
(related)
|
| H00010 | Multiple myeloma |
P04637
(related)
P22607 (related) P30281 (related) |
| H00013 | Small cell lung cancer |
P04637
(related)
|
| H00014 | Non-small cell lung cancer |
P04637
(related)
P08922 (related) Q9UM73 (related) |
| H00015 | Malignant pleural mesothelioma |
P04637
(related)
P08069 (related) |
| H00019 | Pancreatic cancer |
P04637
(related)
P04637 (marker) Q15831 (related) |
| H00020 | Colorectal cancer |
P04637
(related)
P04637 (marker) |
| H00025 | Penile cancer |
P04637
(related)
P04637 (marker) |
| H00026 | Endometrial Cancer |
P04637
(related)
|
| H00027 | Ovarian cancer |
P04637
(related)
P31751 (related) |
| H00029 | Vulvar cancer |
P04637
(related)
|
| H00031 | Breast cancer |
P04637
(related)
|
| H00036 | Osteosarcoma |
P04637
(related)
P08684 (marker) |
| H00038 | Malignant melanoma |
P04637
(related)
|
| H00039 | Basal cell carcinoma |
P04637
(related)
|
| H00040 | Squamous cell carcinoma |
P04637
(related)
|
| H00041 | Kaposi's sarcoma |
P04637
(related)
|
| H00044 | Cancer of the anal canal |
P04637
(related)
|
| H00046 | Cholangiocarcinoma |
P04637
(related)
P08581 (related) |
| H00047 | Gallbladder cancer |
P04637
(related)
|
| H00048 | Hepatocellular carcinoma |
P04637
(related)
|
| H01007 | Choroid plexus papilloma |
P04637
(related)
|
| H00021 | Renal cell carcinoma |
P04637
(marker)
P08581 (related) |
| H00063 | Spinocerebellar ataxia (SCA) |
P05129
(related)
Q99700 (related) Q9NUW8 (related) |
| H00719 | Leprechaunism |
P06213
(related)
|
| H00942 | Rabson-Mendenhall syndrome |
P06213
(related)
|
| H01228 | Insulin-resistant diabetes mellitus with acanthosis nigricans (IRAN) |
P06213
(related)
|
| H01267 | Familial hyperinsulinemic hypoglycemia (HHF) |
P06213
(related)
P35557 (related) |
| H00093 | Combined immunodeficiencies (CIDs) |
P06239
(related)
P43403 (related) |
| H00822 | Renal agenesis and Renal adysplasia |
P07949
(related)
|
| H00910 | Hirschsprung disease (HD) |
P07949
(related)
|
| H00916 | Congenital central hypoventilation syndrome (CCHS) |
P07949
(related)
|
| H00050 | Synovial sarcoma |
P08069
(related)
|
| H01274 | Growth delay due to insulin-like growth factor I resistance |
P08069
(related)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00003 | Acute myeloid leukemia (AML) |
P10721
(related)
P10721 (marker) P36888 (related) |
| H00170 | Piebaldism |
P10721
(related)
|
| H00023 | Testicular cancer |
P10721
(marker)
|
| H00249 | Thyroid hormone resistance syndrome |
P10828
(related)
|
| H00255 | Hypogonadotropic hypogonadism |
P11362
(related)
|
| H00443 | Osteoglophonic dysplasia (OD) |
P11362
(related)
|
| H00458 | Craniosynostosis |
P11362
(related)
P21802 (related) P22607 (related) |
| H00516 | Isolated orofacial clefts |
P11362
(related)
|
| H01207 | Trigonocephaly |
P11362
(related)
|
| H00342 | Tuberculosis |
P11473
(related)
|
| H00784 | Localized autosomal recessive hypotrichosis |
P11473
(related)
|
| H01143 | Vitamin D-dependent rickets |
P11473
(related)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00457 | Primary hypertrophic osteoarthropathy (PHO) |
P15428
(related)
|
| H01246 | Isolated congenital nail clubbing (ICNC) |
P15428
(related)
|
| H00069 | Glycogen storage diseases (GSD) |
P15735
(related)
Q9UGJ0 (related) |
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) |
P16473
(related)
|
| H01269 | Congenital hyperthyroidism |
P16473
(related)
|
| H00642 | Lacrimo-auriculo-dento-digital syndrome (LADD) |
P21802
(related)
P22607 (related) |
| H00505 | FGFR3-related short limb skeletal dysplasias |
P22607
(related)
|
| H00997 | CATSHL syndrome |
P22607
(related)
|
| H01202 | Cataract |
P29317
(related)
|
| H00539 | PTEN hamartoma tumor syndrome (PHTS) |
P31749
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P31751
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00410 | Maturity onset diabetes of the young (MODY) |
P35557
(related)
P51451 (related) |
| H00512 | Permanent neonatal diabetes mellitus (PNDM) |
P35557
(related)
|
| H00535 | Lymphedemas |
P35916
(related)
|
| H00800 | Loeys-Dietz syndrome (LDS) |
P36897
(related)
|
| H00801 | Familial thoracic aortic aneurysm and dissection (TAAD) |
P36897
(related)
Q15746 (related) |
| H00227 | Congenital amegakaryocytic thrombocytopenia (CAMT) |
P40225
(marker)
|
| H00574 | Coffin-Lowry syndrome (CLS) |
P51812
(related)
|
| H00091 | T-B+Severe combined immunodeficiencies (SCIDs) |
P52333
(related)
|
| H00606 | Early infantile epileptic encephalopathy |
P53779
(related)
|
| H00523 | Noonan syndrome and related disorders |
Q02750
(related)
|
| H00531 | Venous malformations |
Q02763
(related)
|
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|
| H00408 | Type I diabetes mellitus |
Q04759
(related)
|
| H00085 | Agammaglobulinemias |
Q06187
(related)
|
| H00254 | Pituitary Dwarfism (PD) |
Q06187
(related)
|
| H00107 | Other well-defined immunodeficiency syndromes |
Q08881
(related)
|
| H00568 | Myotonic dystrophy (DM) |
Q09013
(related)
|
| H00527 | Retinitis pigmentosa (RP) |
Q12866
(related)
|
| H00666 | Peutz-Jeghers syndrome |
Q15831
(related)
|
| H00455 | Spinal muscular atrophy (SMA) |
Q16637
(related)
Q16637 (related) |
| H00777 | Spondylometaepiphyseal dysplasia, short limb-hand type |
Q16832
(related)
|
| H00658 | Syndromic X-linked mental retardation |
Q99714
(related)
|
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency |
Q99714
(related)
|
| H00096 | Defects of toll-like receptor signaling |
Q9NWZ3
(related)
|
| H00292 | Hypertrophic cardiomyopathy (HCM) |
Q9UGJ0
(related)
|
| H01154 | Wolff-Parkinson-White (WPW) syndrome |
Q9UGJ0
(related)
|
| H01282 | Spermatogenic failure |
Q9UQB9
(related)
|