| id | C00025209 |
|---|---|
| Name | Speciociliatin / Speciociliatine |
| CAS RN | 14382-79-7 |
| Standard InChI | InChI=1S/C23H30N2O4/c1-5-14-12-25-10-9-15-21-18(7-6-8-20(21)28-3)24-22(15)19(25)11-16(14)17(13-27-2)23(26)29-4/h6-8,13-14,16,19,24H,5,9-12H2,1-4H3/b17-13-/t14-,16+,19-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H30N2O4/c1-5-14-12-25-10-9-15-21-18(7-6-8-20(21)28-3)24-22(15)19(25)11-16(14)17(13-27-2)23(26)29-4/h6-8,13-14,16,19,24H,5,9-12H2,1-4H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 246 |
| By standard InChI | CHEMBL58496 |
|---|---|
| By standard InChI Main Layer | CHEMBL58496 CHEMBL299031 CHEMBL107364 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Mitragyna speciosa Korth. | 170351 | Rubiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL299031 |
CHEMBL756037
(1)
CHEMBL857861
(1)
|
0 / 0 |