| id | C00025250 |
|---|---|
| Name | Sukhodianine / (-)-Sukhodianine |
| CAS RN | 82413-17-0 |
| Standard InChI | InChI=1S/C20H21NO5/c1-21-7-6-10-8-13-20(26-9-25-13)15-11-4-5-12(23-2)19(24-3)16(11)18(22)17(21)14(10)15/h4-5,8,17-18,22H,6-7,9H2,1-3H3/t17-,18?/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H21NO5/c1-21-7-6-10-8-13-20(26-9-25-13)15-11-4-5-12(23-2)19(24-3)16(11)18(22)17(21)14(10)15/h4-5,8,17-18,22H,6-7,9H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 20 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stephania venosa (Bl.) Spreng. | 147243 | Menispermaceae | eudicotyledons | Viridiplantae |