id | C00025398 |
---|---|
Name | Caryachin / (-)-Caryachine |
CAS RN | 37687-27-7 |
Standard InChI | InChI=1S/C19H19NO4/c1-20-14-4-11-6-18-19(24-9-23-18)8-13(11)15(20)3-10-5-17(22-2)16(21)7-12(10)14/h5-8,14-15,21H,3-4,9H2,1-2H3/t14-,15-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C19H19NO4/c1-20-14-4-11-6-18-19(24-9-23-18)8-13(11)15(20)3-10-5-17(22-2)16(21)7-12(10)14/h5-8,14-15,21H,3-4,9H2,1-2H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 37 |
By standard InChI | CHEMBL480663 |
---|---|
By standard InChI Main Layer | CHEMBL480663 |
By LinkDB |
---|
By CAS RN | C098741 |
---|
class name | count |
---|---|
eudicotyledons | 3 |
Magnoliophyta | 1 |
family name | count |
---|---|
Papaveraceae | 3 |
Lauraceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Cryptocarya chinensis Hemsl. | 22027 | Lauraceae | Magnoliophyta | Viridiplantae |
Eschscholtzia californica Cham | 3465 | Papaveraceae | eudicotyledons | Viridiplantae |
Eschscholtzia douglasii Walp. | 3465 | Papaveraceae | eudicotyledons | Viridiplantae |
Eschscholtzia glauca Greene | 3465 | Papaveraceae | eudicotyledons | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P08908 | 5-hydroxytryptamine receptor 1A | Serotonin receptor | CHEMBL480663 |
CHEMBL972067
(2)
|
1 / 0 |