id | C00025399 |
---|---|
Name | Crychin / Crychine / Californin / Californine / Eschscholtzin / (-)-Eschscholtzine |
CAS RN | 4040-75-9 |
Standard InChI | InChI=1S/C19H17NO4/c1-20-14-2-10-4-16-18(23-8-21-16)6-12(10)15(20)3-11-5-17-19(7-13(11)14)24-9-22-17/h4-7,14-15H,2-3,8-9H2,1H3/t14-,15-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C19H17NO4/c1-20-14-2-10-4-16-18(23-8-21-16)6-12(10)15(20)3-11-5-17-19(7-13(11)14)24-9-22-17/h4-7,14-15H,2-3,8-9H2,1H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 233 |
By standard InChI | CHEMBL481839 |
---|---|
By standard InChI Main Layer | CHEMBL165903 CHEMBL481839 |
By LinkDB |
---|
By CAS RN | C084233 |
---|
class name | count |
---|---|
eudicotyledons | 3 |
Magnoliophyta | 1 |
family name | count |
---|---|
Papaveraceae | 3 |
Lauraceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Cryptocarya chinensis Hemsl. | 22027 | Lauraceae | Magnoliophyta | Viridiplantae |
Eschscholtzia californica Cham | 3465 | Papaveraceae | eudicotyledons | Viridiplantae |
Eschscholtzia douglasii Walp. | 3465 | Papaveraceae | eudicotyledons | Viridiplantae |
Eschscholtzia glauca Greene | 3465 | Papaveraceae | eudicotyledons | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL481839 |
CHEMBL972070
(1)
|
0 / 1 |
P08908 | 5-hydroxytryptamine receptor 1A | Serotonin receptor | CHEMBL481839 |
CHEMBL972067
(2)
|
1 / 0 |