| id | C00025792 |
|---|---|
| Name | Cephasamine |
| CAS RN | 175617-21-7 |
| Standard InChI | InChI=1S/C20H23NO5/c1-21-8-7-20-13-10-5-6-12(23-2)16(13)26-19(20)18(25-4)17(24-3)15(22)14(20)11(21)9-10/h5-6,11,14,19H,7-9H2,1-4H3/t11-,14-,19+,20-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H23NO5/c1-21-8-7-20-13-10-5-6-12(23-2)16(13)26-19(20)18(25-4)17(24-3)15(22)14(20)11(21)9-10/h5-6,11,14,19H,7-9H2,1-4H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 346 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stephania cepharantha Hayata | 147243 | Menispermaceae | eudicotyledons | Viridiplantae |