| id | C00025927 |
|---|---|
| Name | Limacusine / (+)-Limacusine |
| CAS RN | 10172-03-9 |
| Standard InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-31(42-4)33-21-27(24)28(38)17-23-8-11-30(41-3)32(18-23)44-26-9-6-22(7-10-26)16-29-35-25(13-15-39(29)2)20-34(43-5)36(40)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-31(42-4)33-21-27(24)28(38)17-23-8-11-30(41-3)32(18-23)44-26-9-6-22(7-10-26)16-29-35-25(13-15-39(29)2)20-34(43-5)36(40)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 10 |
| By standard InChI | CHEMBL503522 |
|---|---|
| By standard InChI Main Layer | CHEMBL507220 CHEMBL503522 CHEMBL509855 CHEMBL1185978 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 4 |
| family name | count |
|---|---|
| Menispermaceae | 4 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Anisocycla jollyana | 461545 | Menispermaceae | eudicotyledons | Viridiplantae |
| Anisocyla jollyana | 3455 | Menispermaceae | eudicotyledons | Viridiplantae |
| Limacia cuspidata | 3455 | Menispermaceae | eudicotyledons | Viridiplantae |
| Pycnarrhena longifolia (Decne ex.Miq.) Becc. | 432635 | Menispermaceae | eudicotyledons | Viridiplantae |