| id | C00025932 |
|---|---|
| Name | Litseferine / Litseglutine A / (+)-Litseferine |
| CAS RN | 60142-18-9 |
| Standard InChI | InChI=1S/C18H17NO4/c1-21-14-6-10-4-12-16-9(2-3-19-12)5-15-18(23-8-22-15)17(16)11(10)7-13(14)20/h5-7,12,19-20H,2-4,8H2,1H3/t12-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H17NO4/c1-21-14-6-10-4-12-16-9(2-3-19-12)5-15-18(23-8-22-15)17(16)11(10)7-13(14)20/h5-7,12,19-20H,2-4,8H2,1H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 20 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| Lauraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Litsea sebifera | 22042 | Lauraceae | Magnoliophyta | Viridiplantae |
| Stephania cepharantha Hayata | 147243 | Menispermaceae | eudicotyledons | Viridiplantae |