| id | C00025964 |
|---|---|
| Name | Nortiliacorine A |
| CAS RN | 27577-49-7 |
| Standard InChI | InChI=1S/C35H34N2O5/c1-37-11-9-22-17-32(40-3)34-35-33(22)27(37)15-20-5-7-29(39-2)25(13-20)24-12-19(4-6-28(24)38)14-26-23-18-31(42-35)30(41-34)16-21(23)8-10-36-26/h4-7,12-13,16-18,26-27,36,38H,8-11,14-15H2,1-3H3/t26-,27+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C35H34N2O5/c1-37-11-9-22-17-32(40-3)34-35-33(22)27(37)15-20-5-7-29(39-2)25(13-20)24-12-19(4-6-28(24)38)14-26-23-18-31(42-35)30(41-34)16-21(23)8-10-36-26/h4-7,12-13,16-18,26-27,36,38H,8-11,14-15H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 10 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL2017490 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 3 |
| family name | count |
|---|---|
| Menispermaceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Tiliacora dinklagei | 461640 | Menispermaceae | eudicotyledons | Viridiplantae |
| Tiliacora racemosa | 461640 | Menispermaceae | eudicotyledons | Viridiplantae |
| Tiliacora triandra Diels | 461640 | Menispermaceae | eudicotyledons | Viridiplantae |