| id | C00026072 |
|---|---|
| Name | Ushinsunine / Micheline A / (-)-Ushinsunine |
| CAS RN | 3175-89-1 |
| Standard InChI | InChI=1S/C18H17NO3/c1-19-7-6-10-8-13-18(22-9-21-13)15-11-4-2-3-5-12(11)17(20)16(19)14(10)15/h2-5,8,16-17,20H,6-7,9H2,1H3/t16-,17+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H17NO3/c1-19-7-6-10-8-13-18(22-9-21-13)15-11-4-2-3-5-12(11)17(20)16(19)14(10)15/h2-5,8,16-17,20H,6-7,9H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 553 |
| By standard InChI | CHEMBL1617041 |
|---|---|
| By standard InChI Main Layer | CHEMBL221034 CHEMBL1617041 CHEMBL2009013 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stephania epigaea H.S.Lo | 147243 | Menispermaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O14757 | Serine/threonine-protein kinase Chk1 | Chk1 | CHEMBL221034 |
CHEMBL909627
(1)
|
0 / 0 |