| id | C00026247 |
|---|---|
| Name | Luotonin E |
| CAS RN | 244616-84-0 |
| Standard InChI | InChI=1S/C19H13N3O2/c1-24-19-13-10-11-6-2-4-8-14(11)20-16(13)17-21-15-9-5-3-7-12(15)18(23)22(17)19/h2-10,19H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H13N3O2/c1-24-19-13-10-11-6-2-4-8-14(11)20-16(13)17-21-15-9-5-3-7-12(15)18(23)22(17)19/h2-10,19H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8737 |
| By standard InChI | CHEMBL18544 |
|---|---|
| By standard InChI Main Layer | CHEMBL18544 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Nitrariaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Peganum nigellastrum | 673036 | Nitrariaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL18544 |
CHEMBL884429
(1)
|
0 / 0 |
| Q02880 | DNA topoisomerase 2-beta | Isomerase | CHEMBL18544 |
CHEMBL884429
(1)
|
0 / 0 |