| id | C00026250 |
|---|---|
| Name | Peganol |
| CAS RN | 36101-54-9 |
| Standard InChI | InChI=1S/C11H12N2O/c14-11-8-4-1-2-5-9(8)12-10-6-3-7-13(10)11/h1-2,4-5,11,14H,3,6-7H2 |
| Standard InChI (Main Layer) | InChI=1S/C11H12N2O/c14-11-8-4-1-2-5-9(8)12-10-6-3-7-13(10)11/h1-2,4-5,11,14H,3,6-7H2 |
| Phytochemical cluster | No. 7 |
|---|---|
| KCF-S cluster | No. 2365 |
| By standard InChI | CHEMBL2165578 |
|---|---|
| By standard InChI Main Layer | CHEMBL2165578 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Nitrariaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Peganum harmala L. | 43879 | Nitrariaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06276 | Cholinesterase | Hydrolase | CHEMBL2165578 |
CHEMBL2166019
(1)
|
0 / 0 |