| id | C00026252 |
|---|---|
| Name | Vasicine / (-)-Linarine / (-)-Peganine / (-)-Vasicine |
| CAS RN | 6159-55-3 |
| Standard InChI | InChI=1S/C11H12N2O/c14-10-5-6-13-7-8-3-1-2-4-9(8)12-11(10)13/h1-4,10,14H,5-7H2/t10-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C11H12N2O/c14-10-5-6-13-7-8-3-1-2-4-9(8)12-11(10)13/h1-4,10,14H,5-7H2 |
| Phytochemical cluster | No. 7 |
|---|---|
| KCF-S cluster | No. 2365 |
| By standard InChI | CHEMBL2163791 |
|---|---|
| By standard InChI Main Layer | CHEMBL1186527 CHEMBL1456364 CHEMBL2163791 |
| By LinkDB | C10733 |
|---|
| By CAS RN | C019592 |
|---|
| family name | count |
|---|---|
| Acanthaceae | 1 |
| Fabaceae | 1 |
| Nitrariaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Adhatoda vasica Nees | 141317 | Acanthaceae | asterids | Viridiplantae |
| Galega officinalis L. | 47100 | Fabaceae | rosids | Viridiplantae |
| Peganum harmala L. | 43879 | Nitrariaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL1456364 |
CHEMBL1794311
(1)
|
2 / 3 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1456364 |
CHEMBL1738606
(1)
|
0 / 0 |
| P06276 | Cholinesterase | Hydrolase | CHEMBL2163791 |
CHEMBL2166019
(1)
|
0 / 0 |