id | C00026252 |
---|---|
Name | Vasicine / (-)-Linarine / (-)-Peganine / (-)-Vasicine |
CAS RN | 6159-55-3 |
Standard InChI | InChI=1S/C11H12N2O/c14-10-5-6-13-7-8-3-1-2-4-9(8)12-11(10)13/h1-4,10,14H,5-7H2/t10-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C11H12N2O/c14-10-5-6-13-7-8-3-1-2-4-9(8)12-11(10)13/h1-4,10,14H,5-7H2 |
Phytochemical cluster | No. 7 |
---|---|
KCF-S cluster | No. 2365 |
By standard InChI | CHEMBL2163791 |
---|---|
By standard InChI Main Layer | CHEMBL1186527 CHEMBL1456364 CHEMBL2163791 |
By LinkDB | C10733 |
---|
By CAS RN | C019592 |
---|
family name | count |
---|---|
Acanthaceae | 1 |
Fabaceae | 1 |
Nitrariaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Adhatoda vasica Nees | 141317 | Acanthaceae | asterids | Viridiplantae |
Galega officinalis L. | 47100 | Fabaceae | rosids | Viridiplantae |
Peganum harmala L. | 43879 | Nitrariaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL1456364 |
CHEMBL1794311
(1)
|
2 / 3 |
Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1456364 |
CHEMBL1738606
(1)
|
0 / 0 |
P06276 | Cholinesterase | Hydrolase | CHEMBL2163791 |
CHEMBL2166019
(1)
|
0 / 0 |