| id | C00026303 |
|---|---|
| Name | (+/-)-Epilupinine |
| CAS RN | 486-71-5 |
| Standard InChI | InChI=1S/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2 |
| Phytochemical cluster | No. 3 |
|---|---|
| KCF-S cluster | No. 1838 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL459397 CHEMBL1435718 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lupinus palmeri S.Wats. | 3869 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL1435718 |
CHEMBL1614364
(1)
|
1 / 1 |