| id | C00002635 |
|---|---|
| Name | Anacardic acid |
| CAS RN | 16611-84-0 |
| Standard InChI | InChI=1S/C22H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h15,17-18,23H,2-14,16H2,1H3,(H,24,25) |
| Standard InChI (Main Layer) | InChI=1S/C22H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h15,17-18,23H,2-14,16H2,1H3,(H,24,25) |
| Phytochemical cluster | No. 84 |
|---|---|
| KCF-S cluster | No. 3375 |
| By standard InChI | CHEMBL33778 |
|---|---|
| By standard InChI Main Layer | CHEMBL33778 |
| By LinkDB | C10759 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Anacardiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Anacardium occidentale | 171929 | Anacardiaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UBE0 | SUMO-activating enzyme subunit 1 | Unclassified protein | CHEMBL33778 |
CHEMBL2328923
(1)
|
0 / 0 |