| id | C00002637 |
|---|---|
| Name | Antiarol / 3,4,5-Trimethoxyphenol |
| CAS RN | 642-71-7 |
| Standard InChI | InChI=1S/C9H12O4/c1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4-5,10H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C9H12O4/c1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4-5,10H,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 856 |
| By standard InChI | CHEMBL1319047 |
|---|---|
| By standard InChI Main Layer | CHEMBL1319047 |
| By LinkDB | C10765 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Moraceae | 1 |
| Celastraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Antiaris toxicaria | 241857 | Moraceae | rosids | Viridiplantae |
| Tripterygium wilfordii Hook F.(TwHF) | 123484 | Celastraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL1319047 |
CHEMBL1794311
(1)
|
2 / 3 |
| P11021 | 78 kDa glucose-regulated protein | Unclassified protein | CHEMBL1319047 |
CHEMBL1963893
(1)
|
0 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1319047 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL1319047 |
CHEMBL1614250
(1)
CHEMBL1614421
(1)
|
4 / 3 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #607948 | Mycobacterium tuberculosis, susceptibility to |
P11473
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| #277440 | Vitamin d-dependent rickets, type 2a; vddr2a |
P11473
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00342 | Tuberculosis |
P11473
(related)
|
| H00784 | Localized autosomal recessive hypotrichosis |
P11473
(related)
|
| H01143 | Vitamin D-dependent rickets |
P11473
(related)
|