| id | C00026383 | 
|---|---|
| Name | 3-(Indol-3-yl)quinoline / 3-(1H-Indol-3-yl)quinoline | 
| CAS RN | 146535-51-5 | 
| Standard InChI | InChI=1S/C17H12N2/c1-3-7-16-12(5-1)9-13(10-18-16)15-11-19-17-8-4-2-6-14(15)17/h1-11,19H | 
| Standard InChI (Main Layer) | InChI=1S/C17H12N2/c1-3-7-16-12(5-1)9-13(10-18-16)15-11-19-17-8-4-2-6-14(15)17/h1-11,19H | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1963 | 
| By standard InChI | CHEMBL309116 | 
|---|---|
| By standard InChI Main Layer | CHEMBL309116 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| rosids | 1 | 
| family name | count | 
|---|---|
| Nitrariaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Peganum nigellastrum | 673036 | Nitrariaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL309116 | CHEMBL679946
                        (1) | 1 / 11 | 
| P09619 | Platelet-derived growth factor receptor beta | Pdgfr | CHEMBL309116 | CHEMBL763783
                        (1) | 5 / 1 | 
| P16234 | Platelet-derived growth factor receptor alpha | Pdgfr | CHEMBL309116 | CHEMBL763783
                        (1) | 2 / 1 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #615007 | Basal ganglia calcification, idiopathic, 4; ibgc4 | P09619 | 
| #606764 | Gastrointestinal stromal tumor; gist | P16234 | 
| #607685 | Hypereosinophilic syndrome, idiopathic; hes | P16234 | 
| #607785 | Juvenile myelomonocytic leukemia; jmml | P09619 | 
| #601626 | Leukemia, acute myeloid; aml | P09619 | 
| #211980 | Lung cancer | P00533 | 
| #131440 | Myeloproliferative disorder, chronic, with eosinophilia | P09619 | 
| #228550 | Myofibromatosis, infantile, 1; imf1 | P09619 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00016 | Oral cancer | P00533
                            (related) P00533 (marker) | 
| H00017 | Esophageal cancer | P00533
                            (related) | 
| H00018 | Gastric cancer | P00533
                            (related) | 
| H00022 | Bladder cancer | P00533
                            (related) | 
| H00028 | Choriocarcinoma | P00533
                            (related) | 
| H00030 | Cervical cancer | P00533
                            (related) | 
| H00042 | Glioma | P00533
                            (related) P00533 (marker) P09619 (related) P16234 (related) | 
| H00055 | Laryngeal cancer | P00533
                            (related) P00533 (marker) |